7-(Hydroxymethyl)-10-[(4-methoxyphenyl)methyl]-4,9,13,15,29-pentamethyl-24-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-22-oxa-3,6,9,12,15,29-hexazatetracyclo[14.12.2.218,21.123,27]tritriaconta-18,20,23,25,27(31),32-hexaene-2,5,8,11,14,30-hexone
Internal ID | 8e433814-14ba-45ac-9c39-e78bfc21d5e3 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
IUPAC Name | 7-(hydroxymethyl)-10-[(4-methoxyphenyl)methyl]-4,9,13,15,29-pentamethyl-24-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-22-oxa-3,6,9,12,15,29-hexazatetracyclo[14.12.2.218,21.123,27]tritriaconta-18,20,23,25,27(31),32-hexaene-2,5,8,11,14,30-hexone |
SMILES (Canonical) | CC1C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N(C2CC3=CC=C(C=C3)OC4=C(C=CC(=C4)CC(C(=O)N1)N(C2=O)C)OC5C(C(C(C(O5)CO)O)O)O)C)C)CC6=CC=C(C=C6)OC)C)CO |
SMILES (Isomeric) | CC1C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N(C2CC3=CC=C(C=C3)OC4=C(C=CC(=C4)CC(C(=O)N1)N(C2=O)C)OC5C(C(C(C(O5)CO)O)O)O)C)C)CC6=CC=C(C=C6)OC)C)CO |
InChI | InChI=1S/C46H58N6O15/c1-23-40(58)49-30(21-53)44(62)50(3)31(17-25-7-12-28(64-6)13-8-25)42(60)48-24(2)43(61)52(5)33-18-26-9-14-29(15-10-26)65-35-20-27(19-32(41(59)47-23)51(4)45(33)63)11-16-34(35)66-46-39(57)38(56)37(55)36(22-54)67-46/h7-16,20,23-24,30-33,36-39,46,53-57H,17-19,21-22H2,1-6H3,(H,47,59)(H,48,60)(H,49,58) |
InChI Key | FAHSQQJARZIARU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H58N6O15 |
Molecular Weight | 935.00 g/mol |
Exact Mass | 934.39601516 g/mol |
Topological Polar Surface Area (TPSA) | 286.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of 7-(Hydroxymethyl)-10-[(4-methoxyphenyl)methyl]-4,9,13,15,29-pentamethyl-24-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-22-oxa-3,6,9,12,15,29-hexazatetracyclo[14.12.2.218,21.123,27]tritriaconta-18,20,23,25,27(31),32-hexaene-2,5,8,11,14,30-hexone 2D Structure of 7-(Hydroxymethyl)-10-[(4-methoxyphenyl)methyl]-4,9,13,15,29-pentamethyl-24-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-22-oxa-3,6,9,12,15,29-hexazatetracyclo[14.12.2.218,21.123,27]tritriaconta-18,20,23,25,27(31),32-hexaene-2,5,8,11,14,30-hexone](https://plantaedb.com/storage/docs/compounds/2023/11/ec1f7150-86aa-11ee-987c-db6f407e0b56.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.54% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 99.38% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.31% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.84% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.45% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.05% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.55% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.70% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.55% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.73% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.24% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.43% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.47% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.30% | 95.89% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.77% | 96.77% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.82% | 93.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.88% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.42% | 89.00% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.13% | 82.38% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.00% | 97.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.52% | 95.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.04% | 90.71% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.53% | 97.05% |
CHEMBL2535 | P11166 | Glucose transporter | 80.98% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rubia yunnanensis |
PubChem | 75969084 |
LOTUS | LTS0164437 |
wikiData | Q104992268 |