2-[[(4R,5S,7R,25S,26R,29S,30S,31S)-29-(carboxymethyl)-13,14,15,18,20,31,35,36-octahydroxy-2,10,23,28,32-pentaoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,24,27,33-hexaoxaheptacyclo[28.7.1.04,25.07,26.011,16.017,22.034,38]octatriaconta-1(37),11,13,15,17,19,21,34(38),35-nonaen-19-yl]oxy]-3,4,5-trihydroxybenzoic acid
Internal ID | 9f0b4d7c-cf4e-4bd9-b856-6d8721356bf8 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 2-[[(4R,5S,7R,25S,26R,29S,30S,31S)-29-(carboxymethyl)-13,14,15,18,20,31,35,36-octahydroxy-2,10,23,28,32-pentaoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,24,27,33-hexaoxaheptacyclo[28.7.1.04,25.07,26.011,16.017,22.034,38]octatriaconta-1(37),11,13,15,17,19,21,34(38),35-nonaen-19-yl]oxy]-3,4,5-trihydroxybenzoic acid |
SMILES (Canonical) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C(C(C(=O)O3)CC(=O)O)C(C(=O)O6)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O1)O)O)O)O)OC9=C(C(=C(C=C9C(=O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@@H]3[C@@H]([C@H]([C@@H](O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5[C@H]([C@@H](C(=O)O3)CC(=O)O)[C@@H](C(=O)O6)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O1)O)O)O)O)OC9=C(C(=C(C=C9C(=O)O)O)O)O)O |
InChI | InChI=1S/C48H34O32/c49-15-1-9(2-16(50)27(15)57)42(67)80-48-40-39-37(76-46(71)13(7-22(55)56)25-26-12(45(70)79-40)4-19(53)30(60)38(26)77-47(72)33(25)63)21(74-48)8-73-43(68)10-3-17(51)28(58)31(61)23(10)24-11(44(69)78-39)5-20(54)36(32(24)62)75-35-14(41(65)66)6-18(52)29(59)34(35)64/h1-6,13,21,25,33,37,39-40,48-54,57-64H,7-8H2,(H,55,56)(H,65,66)/t13-,21+,25-,33-,37+,39-,40+,48-/m0/s1 |
InChI Key | NMHZKRNTMVFPBS-STRARJFVSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C48H34O32 |
Molecular Weight | 1122.80 g/mol |
Exact Mass | 1122.1033189 g/mol |
Topological Polar Surface Area (TPSA) | 534.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of 2-[[(4R,5S,7R,25S,26R,29S,30S,31S)-29-(carboxymethyl)-13,14,15,18,20,31,35,36-octahydroxy-2,10,23,28,32-pentaoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,24,27,33-hexaoxaheptacyclo[28.7.1.04,25.07,26.011,16.017,22.034,38]octatriaconta-1(37),11,13,15,17,19,21,34(38),35-nonaen-19-yl]oxy]-3,4,5-trihydroxybenzoic acid 2D Structure of 2-[[(4R,5S,7R,25S,26R,29S,30S,31S)-29-(carboxymethyl)-13,14,15,18,20,31,35,36-octahydroxy-2,10,23,28,32-pentaoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,24,27,33-hexaoxaheptacyclo[28.7.1.04,25.07,26.011,16.017,22.034,38]octatriaconta-1(37),11,13,15,17,19,21,34(38),35-nonaen-19-yl]oxy]-3,4,5-trihydroxybenzoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/ec0ac6f0-8710-11ee-8ccb-e507ebd4db36.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.57% | 91.11% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 95.58% | 95.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.36% | 99.15% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 92.75% | 94.42% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.56% | 99.17% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 92.34% | 97.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.07% | 96.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.82% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.75% | 86.33% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 91.55% | 83.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.31% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.25% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.12% | 91.49% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.68% | 89.63% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.87% | 97.21% |
CHEMBL3194 | P02766 | Transthyretin | 87.75% | 90.71% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.89% | 91.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.27% | 95.56% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.33% | 93.18% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.36% | 89.34% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.15% | 91.19% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.56% | 93.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.64% | 95.50% |
CHEMBL2535 | P11166 | Glucose transporter | 81.41% | 98.75% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.04% | 96.37% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.72% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Macaranga sinensis |
PubChem | 16173403 |
LOTUS | LTS0178217 |
wikiData | Q105181787 |