Eburnamonine, 11-methoxy-
| Internal ID | 029550e0-6917-4d90-a237-0f5d410ad023 |
| Taxonomy | Alkaloids and derivatives > Eburnan-type alkaloids |
| IUPAC Name | 15-ethyl-4-methoxy-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2(7),3,5,8(18)-tetraen-17-one |
| SMILES (Canonical) | CCC12CCCN3C1C4=C(CC3)C5=C(N4C(=O)C2)C=C(C=C5)OC |
| SMILES (Isomeric) | CCC12CCCN3C1C4=C(CC3)C5=C(N4C(=O)C2)C=C(C=C5)OC |
| InChI | InChI=1S/C20H24N2O2/c1-3-20-8-4-9-21-10-7-15-14-6-5-13(24-2)11-16(14)22(17(23)12-20)18(15)19(20)21/h5-6,11,19H,3-4,7-10,12H2,1-2H3 |
| InChI Key | QAJSPAOAMMRBED-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.183778013 g/mol |
| Topological Polar Surface Area (TPSA) | 34.50 Ų |
| XlogP | 3.00 |
| QAJSPAOAMMRBED-UHFFFAOYSA-N |
| 11-Methoxy-14,15-dihydroeburnamenin-14-one # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.35% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 95.96% | 93.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.55% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.95% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.89% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.87% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.43% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.92% | 97.25% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.76% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.16% | 86.33% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.68% | 96.77% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.72% | 92.62% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.13% | 97.09% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.07% | 98.59% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.88% | 93.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.87% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.38% | 95.89% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.60% | 90.24% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 83.59% | 95.53% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.98% | 82.38% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.69% | 98.75% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.47% | 90.95% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 80.57% | 91.96% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vinca minor |
| PubChem | 629693 |
| LOTUS | LTS0102863 |
| wikiData | Q105217473 |