3-Chloro-4-ethenyl-4,9,9,20,20-pentamethyl-5-(methylideneamino)-7-oxa-11-azahexacyclo[14.3.1.05,19.06,8.010,18.012,17]icosa-10(18),12,14,16-tetraen-19-ol
| Internal ID | 9114d296-3994-4c87-88d6-a1e6d4622b40 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 3-alkylindoles |
| IUPAC Name | 3-chloro-4-ethenyl-4,9,9,20,20-pentamethyl-5-(methylideneamino)-7-oxa-11-azahexacyclo[14.3.1.05,19.06,8.010,18.012,17]icosa-10(18),12,14,16-tetraen-19-ol |
| SMILES (Canonical) | CC1(C2CC(C(C3(C2(C4=C(C(C5C3O5)(C)C)NC6=CC=CC1=C64)O)N=C)(C)C=C)Cl)C |
| SMILES (Isomeric) | CC1(C2CC(C(C3(C2(C4=C(C(C5C3O5)(C)C)NC6=CC=CC1=C64)O)N=C)(C)C=C)Cl)C |
| InChI | InChI=1S/C26H31ClN2O2/c1-8-24(6)16(27)12-15-22(2,3)13-10-9-11-14-17(13)18-19(29-14)23(4,5)20-21(31-20)26(24,28-7)25(15,18)30/h8-11,15-16,20-21,29-30H,1,7,12H2,2-6H3 |
| InChI Key | MKRVHEXNGFBKJC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H31ClN2O2 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.2074059 g/mol |
| Topological Polar Surface Area (TPSA) | 60.90 Ų |
| XlogP | 6.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.38% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.09% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.10% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.93% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.72% | 97.09% |
| CHEMBL240 | Q12809 | HERG | 89.17% | 89.76% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.72% | 94.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.15% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.36% | 94.73% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.83% | 100.00% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.06% | 94.08% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.38% | 95.89% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 84.25% | 96.39% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 84.05% | 96.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.03% | 85.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.91% | 86.33% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.54% | 88.56% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.00% | 85.30% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.79% | 90.00% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 82.78% | 80.96% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.56% | 91.49% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.80% | 97.25% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.07% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162910724 |
| LOTUS | LTS0017824 |
| wikiData | Q105166177 |