[(2S,4S,5R,7R,8S)-8-[(E,2R)-6-hydroperoxy-6-methylhept-4-en-2-yl]-5-methyl-12-oxo-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-7-yl] acetate
| Internal ID | 143651de-bb9c-4020-8dd7-9935a43cb72b |
| Taxonomy | Organoheterocyclic compounds > Dihydrofurans > Furanones > Butenolides |
| IUPAC Name | [(2S,4S,5R,7R,8S)-8-[(E,2R)-6-hydroperoxy-6-methylhept-4-en-2-yl]-5-methyl-12-oxo-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-7-yl] acetate |
| SMILES (Canonical) | CC1CC(C(C2=C(C3C1C3)C(=O)OC2)C(C)CC=CC(C)(C)OO)OC(=O)C |
| SMILES (Isomeric) | C[C@@H]1C[C@H]([C@H](C2=C([C@@H]3[C@H]1C3)C(=O)OC2)[C@H](C)C/C=C/C(C)(C)OO)OC(=O)C |
| InChI | InChI=1S/C22H32O6/c1-12(7-6-8-22(4,5)28-25)19-17-11-26-21(24)20(17)16-10-15(16)13(2)9-18(19)27-14(3)23/h6,8,12-13,15-16,18-19,25H,7,9-11H2,1-5H3/b8-6+/t12-,13-,15+,16+,18-,19+/m1/s1 |
| InChI Key | SDGDVGLXQFITGK-LSEVXLOGSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21988874 g/mol |
| Topological Polar Surface Area (TPSA) | 82.10 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.92% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.48% | 85.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.37% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.23% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.80% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.21% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.47% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.49% | 86.33% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.43% | 91.24% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.22% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.99% | 97.09% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.01% | 89.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.00% | 99.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.93% | 93.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.92% | 97.21% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.72% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.71% | 96.95% |
| CHEMBL240 | Q12809 | HERG | 81.60% | 89.76% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.63% | 96.47% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.36% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.21% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 102418759 |
| LOTUS | LTS0232119 |
| wikiData | Q105250625 |