(5R,9R,10R,13S,14S,17S)-17-[(2S,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-2,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione
Internal ID | 3ad86cf1-387c-4bb5-867c-b9f7e4ada438 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (5R,9R,10R,13S,14S,17S)-17-[(2S,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-2,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
SMILES (Canonical) | CC(CC(C=C(C)C)O)C1CCC2(C1(CCC3C2=CC(=O)C4C3(CCC(=O)C4(C)C)C)C)C |
SMILES (Isomeric) | C[C@@H](C[C@H](C=C(C)C)O)[C@@H]1CC[C@]2([C@]1(CC[C@H]3C2=CC(=O)[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)C)C |
InChI | InChI=1S/C30H46O3/c1-18(2)15-20(31)16-19(3)21-9-13-30(8)23-17-24(32)26-27(4,5)25(33)11-12-28(26,6)22(23)10-14-29(21,30)7/h15,17,19-22,26,31H,9-14,16H2,1-8H3/t19-,20-,21-,22-,26-,28+,29-,30+/m0/s1 |
InChI Key | ODBXXARCCQCZQP-AYOPCDFHSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H46O3 |
Molecular Weight | 454.70 g/mol |
Exact Mass | 454.34469533 g/mol |
Topological Polar Surface Area (TPSA) | 54.40 Ų |
XlogP | 6.50 |
There are no found synonyms. |
![2D Structure of (5R,9R,10R,13S,14S,17S)-17-[(2S,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-2,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione 2D Structure of (5R,9R,10R,13S,14S,17S)-17-[(2S,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-2,5,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione](https://plantaedb.com/storage/docs/compounds/2023/11/eb068710-862e-11ee-89a9-a9832cae9ffb.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.30% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.64% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.83% | 91.11% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 96.13% | 94.78% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.05% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.06% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.24% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.88% | 85.14% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.46% | 82.69% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.17% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.11% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.82% | 95.89% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.81% | 93.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.93% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.64% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.95% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.23% | 99.23% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.45% | 85.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.21% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dysoxylum variabile |
PubChem | 15507867 |
LOTUS | LTS0163079 |
wikiData | Q105189727 |