[1-[2-[[3-(3-Chloro-4-hydroxyphenyl)-2-hydroxypropanoyl]amino]-4-methylpentanoyl]-2-[4-(diaminomethylideneamino)butylcarbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl] hydrogen sulfate
| Internal ID | 8b008cf6-1269-4d0d-9ab2-c558245e0d20 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Leucine and derivatives |
| IUPAC Name | [1-[2-[[3-(3-chloro-4-hydroxyphenyl)-2-hydroxypropanoyl]amino]-4-methylpentanoyl]-2-[4-(diaminomethylideneamino)butylcarbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl] hydrogen sulfate |
| SMILES (Canonical) | CC(C)CC(C(=O)N1C2CC(CCC2CC1C(=O)NCCCCN=C(N)N)OS(=O)(=O)O)NC(=O)C(CC3=CC(=C(C=C3)O)Cl)O |
| SMILES (Isomeric) | CC(C)CC(C(=O)N1C2CC(CCC2CC1C(=O)NCCCCN=C(N)N)OS(=O)(=O)O)NC(=O)C(CC3=CC(=C(C=C3)O)Cl)O |
| InChI | InChI=1S/C29H45ClN6O9S/c1-16(2)11-21(35-27(40)25(38)13-17-5-8-24(37)20(30)12-17)28(41)36-22-15-19(45-46(42,43)44)7-6-18(22)14-23(36)26(39)33-9-3-4-10-34-29(31)32/h5,8,12,16,18-19,21-23,25,37-38H,3-4,6-7,9-11,13-15H2,1-2H3,(H,33,39)(H,35,40)(H4,31,32,34)(H,42,43,44) |
| InChI Key | QINSXEZKRIOXRD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H45ClN6O9S |
| Molecular Weight | 689.20 g/mol |
| Exact Mass | 688.2657259 g/mol |
| Topological Polar Surface Area (TPSA) | 255.00 Ų |
| XlogP | 1.20 |
| Atomic LogP (AlogP) | 0.61 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 7 |
| Rotatable Bonds | 15 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9100 | 91.00% |
| Caco-2 | - | 0.8641 | 86.41% |
| Blood Brain Barrier | - | 0.6000 | 60.00% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Mitochondria | 0.4252 | 42.52% |
| OATP2B1 inhibitior | - | 0.5727 | 57.27% |
| OATP1B1 inhibitior | + | 0.8513 | 85.13% |
| OATP1B3 inhibitior | + | 0.9367 | 93.67% |
| MATE1 inhibitior | - | 0.8000 | 80.00% |
| OCT2 inhibitior | - | 0.5000 | 50.00% |
| BSEP inhibitior | + | 0.9219 | 92.19% |
| P-glycoprotein inhibitior | + | 0.7152 | 71.52% |
| P-glycoprotein substrate | + | 0.8645 | 86.45% |
| CYP3A4 substrate | + | 0.7380 | 73.80% |
| CYP2C9 substrate | - | 0.6120 | 61.20% |
| CYP2D6 substrate | - | 0.7884 | 78.84% |
| CYP3A4 inhibition | + | 0.5074 | 50.74% |
| CYP2C9 inhibition | - | 0.6875 | 68.75% |
| CYP2C19 inhibition | - | 0.6295 | 62.95% |
| CYP2D6 inhibition | - | 0.8389 | 83.89% |
| CYP1A2 inhibition | - | 0.7297 | 72.97% |
| CYP2C8 inhibition | + | 0.6392 | 63.92% |
| CYP inhibitory promiscuity | - | 0.6692 | 66.92% |
| UGT catelyzed | + | 0.9000 | 90.00% |
| Carcinogenicity (binary) | - | 0.5135 | 51.35% |
| Carcinogenicity (trinary) | Non-required | 0.5721 | 57.21% |
| Eye corrosion | - | 0.9763 | 97.63% |
| Eye irritation | - | 0.9285 | 92.85% |
| Skin irritation | - | 0.7528 | 75.28% |
| Skin corrosion | - | 0.9086 | 90.86% |
| Ames mutagenesis | - | 0.6100 | 61.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5639 | 56.39% |
| Micronuclear | + | 0.9100 | 91.00% |
| Hepatotoxicity | - | 0.5321 | 53.21% |
| skin sensitisation | - | 0.8253 | 82.53% |
| Respiratory toxicity | + | 0.8222 | 82.22% |
| Reproductive toxicity | + | 0.9000 | 90.00% |
| Mitochondrial toxicity | + | 0.6750 | 67.50% |
| Nephrotoxicity | - | 0.8093 | 80.93% |
| Acute Oral Toxicity (c) | III | 0.5776 | 57.76% |
| Estrogen receptor binding | + | 0.8211 | 82.11% |
| Androgen receptor binding | + | 0.7143 | 71.43% |
| Thyroid receptor binding | + | 0.5594 | 55.94% |
| Glucocorticoid receptor binding | + | 0.6713 | 67.13% |
| Aromatase binding | + | 0.6424 | 64.24% |
| PPAR gamma | + | 0.7312 | 73.12% |
| Honey bee toxicity | - | 0.7334 | 73.34% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.5453 | 54.53% |
| Fish aquatic toxicity | + | 0.9712 | 97.12% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.80% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.49% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.61% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.57% | 94.45% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 98.38% | 85.31% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.16% | 91.11% |
| CHEMBL3837 | P07711 | Cathepsin L | 96.82% | 96.61% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.44% | 98.33% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 96.36% | 95.34% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.02% | 98.05% |
| CHEMBL204 | P00734 | Thrombin | 95.50% | 96.01% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 95.26% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 95.10% | 91.19% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 94.32% | 90.24% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.20% | 93.56% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 93.70% | 96.25% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 93.18% | 97.21% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.02% | 96.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.28% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.54% | 90.71% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 91.21% | 99.23% |
| CHEMBL4072 | P07858 | Cathepsin B | 90.93% | 93.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.74% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.26% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.22% | 97.14% |
| CHEMBL5028 | O14672 | ADAM10 | 90.10% | 97.50% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 89.77% | 96.76% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 89.58% | 100.00% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 89.36% | 96.67% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.20% | 96.90% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 88.41% | 92.29% |
| CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 88.25% | 100.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.54% | 100.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.35% | 96.21% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 86.00% | 97.50% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 85.91% | 94.66% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.74% | 97.29% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.61% | 90.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.39% | 96.38% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.06% | 92.88% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 84.57% | 95.52% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 84.05% | 80.71% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.68% | 94.33% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 83.61% | 93.81% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.33% | 96.47% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 82.70% | 97.53% |
| CHEMBL238 | Q01959 | Dopamine transporter | 82.23% | 95.88% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.15% | 90.08% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 80.71% | 96.67% |
| CHEMBL4805 | Q99572 | P2X purinoceptor 7 | 80.45% | 97.50% |
| CHEMBL3025 | P23280 | Carbonic anhydrase VI | 80.41% | 97.50% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.31% | 90.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.16% | 95.89% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 80.14% | 95.58% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163097249 |
| LOTUS | LTS0208153 |
| wikiData | Q104195859 |