[2-[(2R)-2-(acetyloxymethyl)oxiran-2-yl]-5-(2-methylpropanoyloxymethyl)phenyl] (Z)-2-methylbut-2-enoate
| Internal ID | 0f1ab587-f431-4229-934a-d9f481bd8cbb |
| Taxonomy | Benzenoids > Phenol esters |
| IUPAC Name | [2-[(2R)-2-(acetyloxymethyl)oxiran-2-yl]-5-(2-methylpropanoyloxymethyl)phenyl] (Z)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1=C(C=CC(=C1)COC(=O)C(C)C)C2(CO2)COC(=O)C |
| SMILES (Isomeric) | C/C=C(/C)\C(=O)OC1=C(C=CC(=C1)COC(=O)C(C)C)[C@@]2(CO2)COC(=O)C |
| InChI | InChI=1S/C21H26O7/c1-6-14(4)20(24)28-18-9-16(10-25-19(23)13(2)3)7-8-17(18)21(12-27-21)11-26-15(5)22/h6-9,13H,10-12H2,1-5H3/b14-6-/t21-/m0/s1 |
| InChI Key | YRRJFKMEPWJMEN-XLPSYMGOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.16785316 g/mol |
| Topological Polar Surface Area (TPSA) | 91.40 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.64% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.24% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.90% | 94.45% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 92.64% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.33% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.30% | 86.33% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.21% | 90.24% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.12% | 95.89% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.00% | 92.62% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 85.97% | 91.65% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.87% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.77% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.61% | 89.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.04% | 97.25% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.40% | 85.31% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.08% | 94.73% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.06% | 91.19% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.07% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Doronicum hungaricum |
| PubChem | 163188438 |
| LOTUS | LTS0180531 |
| wikiData | Q105353016 |