[(2R,3S,4R,5S,6S)-2-[(2R,3R,4R,6S)-6-[(2R,3R,4R,6S)-6-[(2R,3R,4R,6S)-6-[(2'R,3'R,4S,4'R,6aS,7S,9R,10aS)-9-[(1R)-1-[(3S,8R,9R,10R,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',7-dimethylspiro[5,6a,7,9,10,10a-hexahydropyrano[4,3-d][1,3,6]trioxocine-4,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-5-hydroxy-4-methoxy-6-methyloxan-3-yl] acetate
Internal ID | 84fc4a46-74ea-4c89-8903-c177efae4beb |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(2R,3S,4R,5S,6S)-2-[(2R,3R,4R,6S)-6-[(2R,3R,4R,6S)-6-[(2R,3R,4R,6S)-6-[(2'R,3'R,4S,4'R,6aS,7S,9R,10aS)-9-[(1R)-1-[(3S,8R,9R,10R,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',7-dimethylspiro[5,6a,7,9,10,10a-hexahydropyrano[4,3-d][1,3,6]trioxocine-4,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-5-hydroxy-4-methoxy-6-methyloxan-3-yl] acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5C(OC6(CC5OC)COC7C(OC(CC7OCO6)OC(C)C8(CCC9C8(CCC1C9CC=C2C1(CCC(C2)O)C)C)O)C)C)C)C)C)OC(=O)C)OC)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)O[C@@H]2[C@H](O[C@H](C[C@H]2OC)O[C@@H]3[C@H](O[C@H](C[C@H]3OC)O[C@@H]4[C@H](O[C@H](C[C@H]4OC)O[C@@H]5[C@H](O[C@]6(C[C@H]5OC)CO[C@H]7[C@@H](O[C@@H](C[C@@H]7OCO6)O[C@H](C)[C@]8(CC[C@@H]9[C@]8(CC[C@@H]1[C@H]9CC=C2[C@@]1(CC[C@@H](C2)O)C)C)O)C)C)C)C)C)OC(=O)C)OC)O |
InChI | InChI=1S/C66H108O24/c1-32-54(69)60(75-15)61(85-39(8)67)62(83-32)89-58-36(5)82-52(27-47(58)73-13)87-56-34(3)80-51(25-45(56)71-11)86-57-35(4)81-53(26-46(57)72-12)88-59-37(6)90-65(29-49(59)74-14)30-76-55-33(2)79-50(28-48(55)77-31-78-65)84-38(7)66(70)23-20-44-42-17-16-40-24-41(68)18-21-63(40,9)43(42)19-22-64(44,66)10/h16,32-38,41-62,68-70H,17-31H2,1-15H3/t32-,33-,34+,35+,36+,37+,38+,41-,42+,43+,44-,45+,46+,47+,48-,49+,50+,51-,52-,53-,54-,55-,56+,57+,58+,59+,60+,61-,62+,63-,64+,65+,66-/m0/s1 |
InChI Key | BJXZLDABJGMOSD-QSZQTSKHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C66H108O24 |
Molecular Weight | 1285.50 g/mol |
Exact Mass | 1284.72305431 g/mol |
Topological Polar Surface Area (TPSA) | 262.00 Ų |
XlogP | 4.60 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4R,5S,6S)-2-[(2R,3R,4R,6S)-6-[(2R,3R,4R,6S)-6-[(2R,3R,4R,6S)-6-[(2'R,3'R,4S,4'R,6aS,7S,9R,10aS)-9-[(1R)-1-[(3S,8R,9R,10R,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',7-dimethylspiro[5,6a,7,9,10,10a-hexahydropyrano[4,3-d][1,3,6]trioxocine-4,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-5-hydroxy-4-methoxy-6-methyloxan-3-yl] acetate 2D Structure of [(2R,3S,4R,5S,6S)-2-[(2R,3R,4R,6S)-6-[(2R,3R,4R,6S)-6-[(2R,3R,4R,6S)-6-[(2'R,3'R,4S,4'R,6aS,7S,9R,10aS)-9-[(1R)-1-[(3S,8R,9R,10R,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',7-dimethylspiro[5,6a,7,9,10,10a-hexahydropyrano[4,3-d][1,3,6]trioxocine-4,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-5-hydroxy-4-methoxy-6-methyloxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/ea04aaf0-826b-11ee-8998-238a2680e15b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.30% | 96.09% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 98.70% | 95.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.07% | 94.45% |
CHEMBL204 | P00734 | Thrombin | 96.41% | 96.01% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.68% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.96% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 93.88% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.52% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.25% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.00% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.45% | 91.19% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 92.14% | 95.71% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.43% | 96.77% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.13% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.97% | 97.36% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 89.80% | 92.88% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.50% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.82% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.35% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.15% | 97.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.46% | 94.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.34% | 89.05% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.62% | 95.89% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.24% | 94.08% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.62% | 97.33% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.92% | 97.28% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.45% | 92.50% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.24% | 91.03% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.14% | 91.07% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.71% | 99.23% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.35% | 93.56% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.93% | 100.00% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.42% | 92.78% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.36% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Periploca sepium |
PubChem | 162979474 |
LOTUS | LTS0110710 |
wikiData | Q104937439 |