(E,8R)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyldec-6-enamide
| Internal ID | 451e6ac5-fc09-45da-8e22-e6cf55fde3b9 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | (E,8R)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyldec-6-enamide |
| SMILES (Canonical) | CCC(C)C=CCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
| SMILES (Isomeric) | CC[C@@H](C)/C=C/CCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
| InChI | InChI=1S/C19H29NO3/c1-4-15(2)9-7-5-6-8-10-19(22)20-14-16-11-12-17(21)18(13-16)23-3/h7,9,11-13,15,21H,4-6,8,10,14H2,1-3H3,(H,20,22)/b9-7+/t15-/m1/s1 |
| InChI Key | MLJGZARGNROKAC-LOWQCSRCSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.21474379 g/mol |
| Topological Polar Surface Area (TPSA) | 58.60 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
![2D Structure of (E,8R)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyldec-6-enamide](https://plantaedb.com/storage/docs/compounds/2023/11/e8r-n-4-hydroxy-3-methoxyphenylmethyl-8-methyldec-6-enamide.jpg "2D Structure of (E,8R)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyldec-6-enamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.47% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.14% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.06% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.40% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 96.45% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.78% | 94.45% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 93.74% | 90.20% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.73% | 95.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.21% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.03% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.06% | 90.71% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 87.92% | 90.24% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 86.56% | 96.67% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.43% | 97.21% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.01% | 90.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.43% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.40% | 97.29% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.15% | 94.73% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 82.68% | 89.33% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.20% | 92.88% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.51% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Capsicum annuum |
| PubChem | 163189177 |
| LOTUS | LTS0235488 |
| wikiData | Q105166731 |