2-[2-(10,15-Dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 554c1ce1-a071-4111-b33c-1c1f9217f586 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[2-(10,15-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(C(CC5C4CCC6C5(CC(C(C6)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)C)O)O)O)O)C)O)C)C)OC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(C(CC5C4CCC6C5(CC(C(C6)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)C)O)O)O)O)C)O)C)C)OC1 |
InChI | InChI=1S/C39H64O14/c1-16-8-9-39(48-15-16)17(2)28-25(53-39)11-22-20-7-6-19-10-24(23(41)13-37(19,4)21(20)12-27(42)38(22,28)5)50-36-34(32(46)30(44)26(14-40)51-36)52-35-33(47)31(45)29(43)18(3)49-35/h16-36,40-47H,6-15H2,1-5H3 |
InChI Key | UTGUCVGGRNMCTI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H64O14 |
Molecular Weight | 756.90 g/mol |
Exact Mass | 756.42960671 g/mol |
Topological Polar Surface Area (TPSA) | 217.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
![2D Structure of 2-[2-(10,15-Dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of 2-[2-(10,15-Dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/e8f1a4b0-86b1-11ee-ba2c-d51543ebb4ee.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.13% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.14% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.58% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.25% | 96.61% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.19% | 97.93% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 93.06% | 97.31% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.02% | 95.93% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.54% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.20% | 100.00% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 92.05% | 97.86% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.36% | 95.50% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 90.49% | 95.38% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.23% | 91.49% |
CHEMBL237 | P41145 | Kappa opioid receptor | 89.94% | 98.10% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.54% | 86.33% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.51% | 92.86% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.02% | 97.25% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.93% | 89.05% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.58% | 92.94% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.25% | 96.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.92% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.73% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.71% | 100.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.68% | 98.05% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.57% | 92.50% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.29% | 97.53% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.91% | 97.28% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.88% | 97.50% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.65% | 95.83% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.58% | 89.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.55% | 96.77% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.83% | 86.92% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.43% | 91.24% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 80.41% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hosta sieboldii |
PubChem | 85278853 |
LOTUS | LTS0066580 |
wikiData | Q105278769 |