(10,11-Diacetyloxy-6,12,16-trimethyl-2-methylidene-8-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl) acetate
| Internal ID | b9353f4b-a32b-46ef-8005-6ef41f6cd671 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (10,11-diacetyloxy-6,12,16-trimethyl-2-methylidene-8-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl) acetate |
| SMILES (Canonical) | CC1CCCC(=C)C2CCC3(C2C(=C(C(C1)OC(=O)C)C(C3OC(=O)C)OC(=O)C)C)C |
| SMILES (Isomeric) | CC1CCCC(=C)C2CCC3(C2C(=C(C(C1)OC(=O)C)C(C3OC(=O)C)OC(=O)C)C)C |
| InChI | InChI=1S/C26H38O6/c1-14-9-8-10-15(2)20-11-12-26(7)23(20)16(3)22(21(13-14)30-17(4)27)24(31-18(5)28)25(26)32-19(6)29/h14,20-21,23-25H,2,8-13H2,1,3-7H3 |
| InChI Key | UCSMNCFKDHLLNT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.26683893 g/mol |
| Topological Polar Surface Area (TPSA) | 78.90 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.56% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.10% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.99% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.17% | 94.45% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.74% | 96.38% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.24% | 95.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.51% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.93% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.92% | 98.95% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.16% | 93.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.03% | 98.75% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.98% | 95.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.68% | 100.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 81.91% | 98.10% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.83% | 95.89% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.78% | 97.79% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.31% | 91.24% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.81% | 100.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.71% | 94.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.14% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163074837 |
| LOTUS | LTS0071548 |
| wikiData | Q105270107 |