(5aR,9aS)-10-hydroxy-1-(hydroxymethyl)-11-methoxy-6,6,9a-trimethyl-1,4,5,5a,8,9-hexahydronaphtho[1,2-g][2]benzofuran-3,7-dione
| Internal ID | 7fb6ae2a-92ad-4a49-bf7a-73a7105e8e04 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives |
| IUPAC Name | (5aR,9aS)-10-hydroxy-1-(hydroxymethyl)-11-methoxy-6,6,9a-trimethyl-1,4,5,5a,8,9-hexahydronaphtho[1,2-g][2]benzofuran-3,7-dione |
| SMILES (Canonical) | CC1(C2CCC3=C4C(=C(C(=C3C2(CCC1=O)C)O)OC)C(OC4=O)CO)C |
| SMILES (Isomeric) | C[C@]12CCC(=O)C([C@@H]1CCC3=C4C(=C(C(=C23)O)OC)C(OC4=O)CO)(C)C |
| InChI | InChI=1S/C21H26O6/c1-20(2)12-6-5-10-14-15(11(9-22)27-19(14)25)18(26-4)17(24)16(10)21(12,3)8-7-13(20)23/h11-12,22,24H,5-9H2,1-4H3/t11?,12-,21-/m0/s1 |
| InChI Key | VFAWCZCJUTVMRS-DCNBDAKASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.05% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.75% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.74% | 94.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.72% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.69% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.26% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.49% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.70% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.70% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.65% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.02% | 91.19% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.90% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.67% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Swartzia arborescens |
| PubChem | 15762193 |
| LOTUS | LTS0210418 |
| wikiData | Q105285010 |