[(4aR,5S,7R,9aR)-9a-hydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-7-yl] 2-methylbut-2-enoate
Internal ID | 38e17559-1052-48d8-b3ef-189878ebe6e9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [(4aR,5S,7R,9aR)-9a-hydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-7-yl] 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C2(CC3=C(C(=O)OC3(C=C2C1)O)C)C)C |
SMILES (Isomeric) | CC=C(C)C(=O)O[C@@H]1C[C@@H]([C@]2(CC3=C(C(=O)O[C@@]3(C=C2C1)O)C)C)C |
InChI | InChI=1S/C20H26O5/c1-6-11(2)17(21)24-15-7-12(3)19(5)10-16-13(4)18(22)25-20(16,23)9-14(19)8-15/h6,9,12,15,23H,7-8,10H2,1-5H3/t12-,15+,19+,20+/m0/s1 |
InChI Key | XPVRJYRKVSBAFV-PYDATULPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H26O5 |
Molecular Weight | 346.40 g/mol |
Exact Mass | 346.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 2.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.43% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.46% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.22% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.95% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.33% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.24% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.50% | 99.23% |
CHEMBL240 | Q12809 | HERG | 87.78% | 89.76% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.92% | 92.94% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.75% | 91.07% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.40% | 91.19% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.14% | 93.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.26% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.58% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.51% | 90.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.49% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Synotis erythropappa |
PubChem | 162930855 |
LOTUS | LTS0256348 |
wikiData | Q105339017 |