(3aS,5aR,6R,9aS,9bS)-6-hydroxy-5a-methyl-3-methylidene-9-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-2-one
Internal ID | 9dceb96d-8a7e-43f5-aba9-cb630f61010c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Eudesmanolides, secoeudesmanolides, and derivatives |
IUPAC Name | (3aS,5aR,6R,9aS,9bS)-6-hydroxy-5a-methyl-3-methylidene-9-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-2-one |
SMILES (Canonical) | CC12CCC3C(C1C(=CCC2O)COC4C(C(C(C(O4)CO)O)O)O)OC(=O)C3=C |
SMILES (Isomeric) | C[C@@]12CC[C@@H]3[C@@H]([C@H]1C(=CC[C@H]2O)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC(=O)C3=C |
InChI | InChI=1S/C21H30O9/c1-9-11-5-6-21(2)13(23)4-3-10(14(21)18(11)30-19(9)27)8-28-20-17(26)16(25)15(24)12(7-22)29-20/h3,11-18,20,22-26H,1,4-8H2,2H3/t11-,12+,13+,14+,15+,16-,17+,18-,20+,21-/m0/s1 |
InChI Key | MKNNVIJIFFANHP-YFOMKJGISA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H30O9 |
Molecular Weight | 426.50 g/mol |
Exact Mass | 426.18898253 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | -0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.00% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.04% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.03% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.46% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.04% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.70% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.00% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.80% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.52% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 86.22% | 98.95% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.13% | 95.83% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.01% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.00% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.40% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.88% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.80% | 95.93% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.72% | 94.73% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.73% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ixeris repens |
PubChem | 101589322 |
LOTUS | LTS0086205 |
wikiData | Q105115991 |