(1S,6S,13R)-1-hydroxy-6-(3-hydroxyprop-1-en-2-yl)-16,17-dimethoxy-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-one
Internal ID | 8bade04e-cc11-46eb-8424-2b13e1896737 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Rotenoids > Rotenones |
IUPAC Name | (1S,6S,13R)-1-hydroxy-6-(3-hydroxyprop-1-en-2-yl)-16,17-dimethoxy-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C3C(=O)C4=C(C5=C(C=C4)OC(C5)C(=C)CO)OC3(CO2)O)OC |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)[C@@H]3C(=O)C4=C(C5=C(C=C4)O[C@@H](C5)C(=C)CO)O[C@@]3(CO2)O)OC |
InChI | InChI=1S/C23H22O8/c1-11(9-24)16-7-14-15(30-16)5-4-12-21(25)20-13-6-18(27-2)19(28-3)8-17(13)29-10-23(20,26)31-22(12)14/h4-6,8,16,20,24,26H,1,7,9-10H2,2-3H3/t16-,20+,23+/m0/s1 |
InChI Key | LEBAJWSMKUWLHA-LERMDLETSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H22O8 |
Molecular Weight | 426.40 g/mol |
Exact Mass | 426.13146766 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of (1S,6S,13R)-1-hydroxy-6-(3-hydroxyprop-1-en-2-yl)-16,17-dimethoxy-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-one 2D Structure of (1S,6S,13R)-1-hydroxy-6-(3-hydroxyprop-1-en-2-yl)-16,17-dimethoxy-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-one](https://plantaedb.com/storage/docs/compounds/2023/11/e8060e20-8639-11ee-a22c-0b8f7b396ca7.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.41% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.42% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.39% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.39% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.11% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.98% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.89% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.34% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.34% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 88.08% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.70% | 90.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.08% | 94.80% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.42% | 89.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.17% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.66% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.24% | 92.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.61% | 96.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 84.22% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.48% | 92.94% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 82.05% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.22% | 94.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.76% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.37% | 94.45% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.10% | 83.82% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.01% | 92.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Amorpha fruticosa |
PubChem | 162853181 |
LOTUS | LTS0073441 |
wikiData | Q105150484 |