[4,5-Dihydroxy-2-[7-hydroxy-2-(2-hydroxypropyl)-5-methyl-4-oxochromen-8-yl]-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | e066d729-cdbd-45b3-9cdb-a31211cf0171 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | [4,5-dihydroxy-2-[7-hydroxy-2-(2-hydroxypropyl)-5-methyl-4-oxochromen-8-yl]-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1=CC(=C(C2=C1C(=O)C=C(O2)CC(C)O)C3C(C(C(C(O3)CO)O)O)OC(=O)C=CC4=CC=C(C=C4)O)O |
SMILES (Isomeric) | CC1=CC(=C(C2=C1C(=O)C=C(O2)CC(C)O)C3C(C(C(C(O3)CO)O)O)OC(=O)C=CC4=CC=C(C=C4)O)O |
InChI | InChI=1S/C28H30O11/c1-13-9-18(32)23(26-22(13)19(33)11-17(37-26)10-14(2)30)27-28(25(36)24(35)20(12-29)38-27)39-21(34)8-5-15-3-6-16(31)7-4-15/h3-9,11,14,20,24-25,27-32,35-36H,10,12H2,1-2H3 |
InChI Key | WDKRSVFLKZPETK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H30O11 |
Molecular Weight | 542.50 g/mol |
Exact Mass | 542.17881177 g/mol |
Topological Polar Surface Area (TPSA) | 183.00 Ų |
XlogP | 1.40 |
There are no found synonyms. |
![2D Structure of [4,5-Dihydroxy-2-[7-hydroxy-2-(2-hydroxypropyl)-5-methyl-4-oxochromen-8-yl]-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [4,5-Dihydroxy-2-[7-hydroxy-2-(2-hydroxypropyl)-5-methyl-4-oxochromen-8-yl]-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/e803f6b0-8090-11ee-819d-43fbcb14d48b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.05% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.65% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.48% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.37% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.27% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.73% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.51% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.07% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.23% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 88.86% | 90.71% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.44% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.82% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.85% | 96.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.18% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.92% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aloe perfoliata |
PubChem | 75581317 |
LOTUS | LTS0218846 |
wikiData | Q105302484 |