[(E,7S,11S)-3,7,11,15-tetramethylhexadec-2-enyl] hexadecanoate
Internal ID | d925f680-669a-401a-bcd1-ddb92ca29241 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters > Wax esters > Wax monoesters |
IUPAC Name | [(E,7S,11S)-3,7,11,15-tetramethylhexadec-2-enyl] hexadecanoate |
SMILES (Canonical) | CCCCCCCCCCCCCCCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C |
SMILES (Isomeric) | CCCCCCCCCCCCCCCC(=O)OC/C=C(\C)/CCC[C@@H](C)CCC[C@@H](C)CCCC(C)C |
InChI | InChI=1S/C36H70O2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-29-36(37)38-31-30-35(6)28-22-27-34(5)26-21-25-33(4)24-20-23-32(2)3/h30,32-34H,7-29,31H2,1-6H3/b35-30+/t33-,34-/m0/s1 |
InChI Key | JDFCEOMVLWWUMP-JMPRYCIKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H70O2 |
Molecular Weight | 534.90 g/mol |
Exact Mass | 534.53758147 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 16.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.83% | 99.17% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.29% | 97.29% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.68% | 89.63% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.26% | 92.86% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.70% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.67% | 98.95% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.79% | 92.08% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 91.24% | 85.94% |
CHEMBL299 | P17252 | Protein kinase C alpha | 90.71% | 98.03% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.68% | 93.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.79% | 94.45% |
CHEMBL1907 | P15144 | Aminopeptidase N | 87.78% | 93.31% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.29% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.21% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.77% | 94.73% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 84.93% | 87.45% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.44% | 96.47% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.35% | 89.34% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.06% | 90.71% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 83.35% | 91.81% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.18% | 91.19% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.48% | 100.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.23% | 82.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.72% | 91.11% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 81.63% | 97.79% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.38% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fatsia japonica |
PubChem | 163010838 |
LOTUS | LTS0158989 |
wikiData | Q105125420 |