(E,7R,11R)-3,7,11,15-tetramethyloctadec-2-en-1-ol
| Internal ID | 3793d50a-8df2-4898-abcb-d4467a61abd0 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Acyclic diterpenoids |
| IUPAC Name | (E,7R,11R)-3,7,11,15-tetramethyloctadec-2-en-1-ol |
| SMILES (Canonical) | CCCC(C)CCCC(C)CCCC(C)CCCC(=CCO)C |
| SMILES (Isomeric) | CCCC(C)CCC[C@@H](C)CCC[C@@H](C)CCC/C(=C/CO)/C |
| InChI | InChI=1S/C22H44O/c1-6-10-19(2)11-7-12-20(3)13-8-14-21(4)15-9-16-22(5)17-18-23/h17,19-21,23H,6-16,18H2,1-5H3/b22-17+/t19?,20-,21-/m1/s1 |
| InChI Key | RJPVZHPAFRZZGC-JSVAJZLASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H44O |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 324.339216023 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 9.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 92.59% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.58% | 97.29% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.49% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.64% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.25% | 99.17% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.60% | 92.86% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 84.42% | 87.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.42% | 97.25% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.75% | 93.31% |
| CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 80.73% | 95.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.61% | 100.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 80.61% | 97.23% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.51% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Akebia trifoliata |
| PubChem | 163191143 |
| LOTUS | LTS0085348 |
| wikiData | Q105237675 |