[(1R,2R,4S,5R,6S,10S)-6-[(2E,6S)-6-hydroxy-2,6-dimethylocta-2,7-dienoyl]oxy-2-methyl-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] (2E,6S)-6-hydroxy-2,6-dimethylocta-2,7-dienoate
| Internal ID | 8acbbd26-78d9-43f9-9cc4-5f50a3ab1a20 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | [(1R,2R,4S,5R,6S,10S)-6-[(2E,6S)-6-hydroxy-2,6-dimethylocta-2,7-dienoyl]oxy-2-methyl-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] (2E,6S)-6-hydroxy-2,6-dimethylocta-2,7-dienoate |
| SMILES (Canonical) | CC(=CCCC(C)(C=C)O)C(=O)OC1C2C(O2)(C3C1(C=COC3OC4C(C(C(C(O4)CO)O)O)O)OC(=O)C(=CCCC(C)(C=C)O)C)C |
| SMILES (Isomeric) | C/C(=C\CC[C@@](C)(C=C)O)/C(=O)O[C@@H]1[C@H]2[C@](O2)([C@@H]3[C@]1(C=CO[C@H]3O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC(=O)/C(=C/CC[C@@](C)(C=C)O)/C)C |
| InChI | InChI=1S/C35H50O14/c1-8-32(5,42)14-10-12-19(3)28(40)46-27-26-34(7,48-26)25-31(47-30-24(39)23(38)22(37)21(18-36)45-30)44-17-16-35(25,27)49-29(41)20(4)13-11-15-33(6,43)9-2/h8-9,12-13,16-17,21-27,30-31,36-39,42-43H,1-2,10-11,14-15,18H2,3-7H3/b19-12+,20-13+/t21-,22-,23+,24-,25-,26+,27-,30+,31+,32-,33-,34-,35+/m1/s1 |
| InChI Key | DLEDZPJSLRXIIO-GUGXBDAHSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C35H50O14 |
| Molecular Weight | 694.80 g/mol |
| Exact Mass | 694.32005626 g/mol |
| Topological Polar Surface Area (TPSA) | 214.00 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.10% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.52% | 94.73% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.68% | 96.61% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 90.11% | 91.24% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.06% | 96.09% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.50% | 91.07% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.13% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.08% | 97.25% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.74% | 96.47% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.36% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.16% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.33% | 99.17% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.09% | 97.36% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.10% | 96.90% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.08% | 97.47% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.13% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Kickxia elatine |
| PubChem | 163023059 |
| LOTUS | LTS0216010 |
| wikiData | Q104984212 |