6-O-(3,4,5-Trihydroxybenzoyl)-beta-D-glucopyranosyl (3beta)-3-(alpha-L-arabinopyranosyloxy)-19-hydroxyurs-12-en-28-oate
Internal ID | 62dc4858-6857-4f16-9a66-81662bafa8da |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-2-yl] (1R,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-1-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-10-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
SMILES (Canonical) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C(C(CO6)O)O)O)C)C)C2C1(C)O)C)C(=O)OC7C(C(C(C(O7)COC(=O)C8=CC(=C(C(=C8)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@H](CO6)O)O)O)C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)COC(=O)C8=CC(=C(C(=C8)O)O)O)O)O)O |
InChI | InChI=1S/C48H70O17/c1-22-10-15-48(42(59)65-41-37(57)35(55)34(54)28(63-41)21-61-39(58)23-18-25(49)32(52)26(50)19-23)17-16-45(5)24(38(48)47(22,7)60)8-9-30-44(4)13-12-31(43(2,3)29(44)11-14-46(30,45)6)64-40-36(56)33(53)27(51)20-62-40/h8,18-19,22,27-31,33-38,40-41,49-57,60H,9-17,20-21H2,1-7H3/t22-,27+,28-,29+,30-,31+,33+,34-,35+,36-,37-,38-,40+,41+,44+,45-,46-,47-,48+/m1/s1 |
InChI Key | MBFMXPAPAAZQQU-BEYSPQKUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H70O17 |
Molecular Weight | 919.10 g/mol |
Exact Mass | 918.46130076 g/mol |
Topological Polar Surface Area (TPSA) | 283.00 Ų |
XlogP | 3.20 |
356785-75-6 |
6-O-(3,4,5-Trihydroxybenzoyl)-beta-D-glucopyranosyl (3beta)-3-(alpha-L-arabinopyranosyloxy)-19-hydroxyurs-12-en-28-oate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.42% | 91.11% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 99.25% | 95.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.41% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.80% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.23% | 92.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.61% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.49% | 95.93% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.31% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.82% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.51% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.26% | 92.94% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.90% | 94.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.52% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.33% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.37% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.83% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.22% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.68% | 95.89% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.32% | 96.90% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.82% | 83.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.32% | 99.17% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.08% | 96.77% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.91% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.80% | 92.62% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 80.29% | 85.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sanguisorba officinalis |
PubChem | 101135527 |
LOTUS | LTS0264820 |
wikiData | Q105160703 |