[(2R,3S,4S,5R,6S)-6-[(2S,3R,4S,5S,6R)-2-[2-(3,4-dihydroxyphenyl)-5,6-dihydroxy-4-oxochromen-7-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl benzoate
| Internal ID | 292e2255-c196-4a06-bd3a-1adf2e9e928d |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[(2S,3R,4S,5S,6R)-2-[2-(3,4-dihydroxyphenyl)-5,6-dihydroxy-4-oxochromen-7-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl benzoate |
| SMILES (Canonical) | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)OC3C(C(C(OC3OC4=C(C(=C5C(=C4)OC(=CC5=O)C6=CC(=C(C=C6)O)O)O)O)CO)O)O)O)O)O |
| SMILES (Isomeric) | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O[C@@H]3[C@H]([C@@H]([C@H](O[C@H]3OC4=C(C(=C5C(=C4)OC(=CC5=O)C6=CC(=C(C=C6)O)O)O)O)CO)O)O)O)O)O |
| InChI | InChI=1S/C34H34O18/c35-11-21-25(40)29(44)31(52-33-30(45)28(43)26(41)22(51-33)12-47-32(46)13-4-2-1-3-5-13)34(50-21)49-20-10-19-23(27(42)24(20)39)17(38)9-18(48-19)14-6-7-15(36)16(37)8-14/h1-10,21-22,25-26,28-31,33-37,39-45H,11-12H2/t21-,22-,25-,26-,28+,29+,30-,31-,33+,34-/m1/s1 |
| InChI Key | HIPYXRMHVZKRLC-BHGGZWEWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H34O18 |
| Molecular Weight | 730.60 g/mol |
| Exact Mass | 730.17451423 g/mol |
| Topological Polar Surface Area (TPSA) | 292.00 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.43% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.89% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.43% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.14% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.94% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.63% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.91% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.58% | 99.17% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 90.43% | 83.00% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.36% | 95.64% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 89.80% | 94.45% |
| CHEMBL3194 | P02766 | Transthyretin | 87.93% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.94% | 94.73% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.20% | 95.50% |
| CHEMBL3891 | P07384 | Calpain 1 | 86.06% | 93.04% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 85.84% | 89.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.18% | 99.15% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.83% | 96.21% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.74% | 95.17% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 83.72% | 83.57% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.52% | 86.92% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.28% | 99.23% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.70% | 95.83% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.13% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Globularia bisnagarica |
| PubChem | 102285489 |
| LOTUS | LTS0122049 |
| wikiData | Q105028960 |