[5,6-Dihydroxy-7-(hydroxymethyl)-3,11,14-trimethyl-4-(2-methylbut-2-enoyloxy)-15-oxo-11-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl]methyl benzoate
| Internal ID | 204a8794-7325-4bc1-a977-88e9702c0be2 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Tigliane and ingenane diterpenoids |
| IUPAC Name | [5,6-dihydroxy-7-(hydroxymethyl)-3,11,14-trimethyl-4-(2-methylbut-2-enoyloxy)-15-oxo-11-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl]methyl benzoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1C(=CC23C1(C(C(=CC(C2=O)C4C(C4(C)COC(=O)C5=CC=CC=C5)CC3C)CO)O)O)C |
| SMILES (Isomeric) | CC=C(C)C(=O)OC1C(=CC23C1(C(C(=CC(C2=O)C4C(C4(C)COC(=O)C5=CC=CC=C5)CC3C)CO)O)O)C |
| InChI | InChI=1S/C32H38O8/c1-6-17(2)28(36)40-27-18(3)14-31-19(4)12-23-24(22(26(31)35)13-21(15-33)25(34)32(27,31)38)30(23,5)16-39-29(37)20-10-8-7-9-11-20/h6-11,13-14,19,22-25,27,33-34,38H,12,15-16H2,1-5H3 |
| InChI Key | WDZQMGLXMSFDSW-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C32H38O8 |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.25666817 g/mol |
| Topological Polar Surface Area (TPSA) | 130.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of [5,6-Dihydroxy-7-(hydroxymethyl)-3,11,14-trimethyl-4-(2-methylbut-2-enoyloxy)-15-oxo-11-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl]methyl benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/e7a1c690-85f9-11ee-8bd0-ef4ec07b47cb.jpg "2D Structure of [5,6-Dihydroxy-7-(hydroxymethyl)-3,11,14-trimethyl-4-(2-methylbut-2-enoyloxy)-15-oxo-11-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl]methyl benzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2996 | Q05655 | Protein kinase C delta | 99.38% | 97.79% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.49% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.33% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.67% | 95.56% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 95.55% | 94.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.70% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.01% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.78% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.41% | 97.09% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.83% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.79% | 89.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.27% | 82.69% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.08% | 96.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.13% | 99.23% |
| CHEMBL5028 | O14672 | ADAM10 | 84.99% | 97.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.60% | 91.07% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.49% | 93.00% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 80.60% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia canariensis |
| PubChem | 85155182 |
| LOTUS | LTS0129817 |
| wikiData | Q105302787 |