[5-Acetyloxy-6-[2-(3,4-dihydroxyphenyl)ethoxy]-4-(3,4,5-triacetyloxy-6-methyloxan-2-yl)oxy-2-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate
| Internal ID | 0dff3647-d92d-4ede-87b6-9ef74ab1422d |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | [5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)ethoxy]-4-(3,4,5-triacetyloxy-6-methyloxan-2-yl)oxy-2-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C)OCCC3=CC(=C(C=C3)O)O)COC4C(C(C(C(O4)CO)O)O)O)OC(=O)C=CC5=CC=C(C=C5)O)OC(=O)C)OC(=O)C)OC(=O)C |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C)OCCC3=CC(=C(C=C3)O)O)COC4C(C(C(C(O4)CO)O)O)O)OC(=O)C=CC5=CC=C(C=C5)O)OC(=O)C)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C43H54O23/c1-19-35(59-20(2)45)37(60-21(3)46)40(62-23(5)48)43(58-19)66-38-36(65-31(52)13-9-24-6-10-26(49)11-7-24)30(18-57-41-34(55)33(54)32(53)29(17-44)63-41)64-42(39(38)61-22(4)47)56-15-14-25-8-12-27(50)28(51)16-25/h6-13,16,19,29-30,32-44,49-51,53-55H,14-15,17-18H2,1-5H3 |
| InChI Key | RXNLEZWNLDZDHM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C43H54O23 |
| Molecular Weight | 938.90 g/mol |
| Exact Mass | 938.30558797 g/mol |
| Topological Polar Surface Area (TPSA) | 329.00 Ų |
| XlogP | 0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.63% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.47% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.79% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.99% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.89% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.76% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.59% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.39% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 92.29% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.61% | 91.49% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.37% | 86.92% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.74% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.58% | 95.93% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.51% | 94.80% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.78% | 94.45% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.57% | 96.95% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 85.39% | 85.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.26% | 90.00% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 83.31% | 96.37% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.96% | 80.78% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.04% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73818352 |
| LOTUS | LTS0098912 |
| wikiData | Q105247175 |