(1S,4S,5R,6S,7S,17S)-7-(chloromethyl)-4,7-dihydroxy-4,5,6-trimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione
Internal ID | 168eb2c2-3c2b-4984-9b4b-834b806eac27 |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | (1S,4S,5R,6S,7S,17S)-7-(chloromethyl)-4,7-dihydroxy-4,5,6-trimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione |
SMILES (Canonical) | CC1C(C(C(=O)OCC2=CCN3C2C(CC3)OC(=O)C1(C)O)(CCl)O)C |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@](C(=O)OCC2=CCN3[C@@H]2[C@H](CC3)OC(=O)[C@@]1(C)O)(CCl)O)C |
InChI | InChI=1S/C18H26ClNO6/c1-10-11(2)18(24,9-19)16(22)25-8-12-4-6-20-7-5-13(14(12)20)26-15(21)17(10,3)23/h4,10-11,13-14,23-24H,5-9H2,1-3H3/t10-,11+,13+,14+,17+,18+/m1/s1 |
InChI Key | GNURZNZKAWCDSY-ADPYHPOGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H26ClNO6 |
Molecular Weight | 387.90 g/mol |
Exact Mass | 387.1448652 g/mol |
Topological Polar Surface Area (TPSA) | 96.30 Ų |
XlogP | 0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.60% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.58% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.24% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.27% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.00% | 86.33% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.23% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.58% | 94.45% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.58% | 93.40% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.14% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.25% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 81.82% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.06% | 97.09% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.95% | 86.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.68% | 100.00% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 80.10% | 94.66% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio latifolius |
PubChem | 162903450 |
LOTUS | LTS0056970 |
wikiData | Q105013355 |