(E,6R)-6-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dec-4-en-3-one
Internal ID | e15db3a1-3f6e-434e-b8e4-081fdad87be1 |
Taxonomy | Benzenoids > Phenols > Methoxyphenols > Shogaols |
IUPAC Name | (E,6R)-6-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dec-4-en-3-one |
SMILES (Canonical) | CCCCC(C=CC(=O)CCC1=CC(=C(C=C1)O)OC)O |
SMILES (Isomeric) | CCCC[C@H](/C=C/C(=O)CCC1=CC(=C(C=C1)O)OC)O |
InChI | InChI=1S/C17H24O4/c1-3-4-5-14(18)9-10-15(19)8-6-13-7-11-16(20)17(12-13)21-2/h7,9-12,14,18,20H,3-6,8H2,1-2H3/b10-9+/t14-/m1/s1 |
InChI Key | SEWFXECKZBLANJ-ATWMFIQVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H24O4 |
Molecular Weight | 292.40 g/mol |
Exact Mass | 292.16745924 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.24% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 97.67% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.47% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.12% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.76% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.49% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.09% | 90.71% |
CHEMBL1907 | P15144 | Aminopeptidase N | 89.03% | 93.31% |
CHEMBL2535 | P11166 | Glucose transporter | 88.29% | 98.75% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.29% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.20% | 95.56% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 86.09% | 92.08% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.70% | 95.50% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 84.54% | 90.20% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.34% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.32% | 94.73% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.44% | 95.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 162944027 |
LOTUS | LTS0094069 |
wikiData | Q105251567 |