(2S)-N-[(2S)-1-[[(2S)-1-[[(2S,5S,8S,11R,12S,15S,18S,21R)-5-[(3-bromo-4-hydroxyphenyl)methyl]-21-hydroxy-2-[(1S)-1-hydroxyethyl]-15-[(4-hydroxyphenyl)methyl]-4,11-dimethyl-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]-2-[[(2R)-2,3-dihydroxypropanoyl]amino]-5-(4-hydroxyphenyl)pentanamide
| Internal ID | 2ad5edb8-92b7-4efb-9c4e-347a4be928a6 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2S)-N-[(2S)-1-[[(2S)-1-[[(2S,5S,8S,11R,12S,15S,18S,21R)-5-[(3-bromo-4-hydroxyphenyl)methyl]-21-hydroxy-2-[(1S)-1-hydroxyethyl]-15-[(4-hydroxyphenyl)methyl]-4,11-dimethyl-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]-2-[[(2R)-2,3-dihydroxypropanoyl]amino]-5-(4-hydroxyphenyl)pentanamide |
| SMILES (Canonical) | CC1C(C(=O)NC(C(=O)NC2CCC(N(C2=O)C(C(=O)N(C(C(=O)NC(C(=O)O1)C(C)C)CC3=CC(=C(C=C3)O)Br)C)C(C)O)O)CC4=CC=C(C=C4)O)NC(=O)C(C(C)C)NC(=O)C(C)NC(=O)C(CCCC5=CC=C(C=C5)O)NC(=O)C(CO)O |
| SMILES (Isomeric) | C[C@@H]1[C@@H](C(=O)N[C@H](C(=O)N[C@H]2CC[C@H](N(C2=O)[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)O1)C(C)C)CC3=CC(=C(C=C3)O)Br)C)[C@H](C)O)O)CC4=CC=C(C=C4)O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCCC5=CC=C(C=C5)O)NC(=O)[C@@H](CO)O |
| InChI | InChI=1S/C59H80BrN9O18/c1-28(2)46(65-50(77)30(5)61-51(78)39(62-54(81)44(75)27-70)11-9-10-33-12-17-36(72)18-13-33)55(82)67-48-32(7)87-59(86)47(29(3)4)66-53(80)42(26-35-16-22-43(74)38(60)24-35)68(8)58(85)49(31(6)71)69-45(76)23-21-40(57(69)84)63-52(79)41(64-56(48)83)25-34-14-19-37(73)20-15-34/h12-20,22,24,28-32,39-42,44-49,70-76H,9-11,21,23,25-27H2,1-8H3,(H,61,78)(H,62,81)(H,63,79)(H,64,83)(H,65,77)(H,66,80)(H,67,82)/t30-,31-,32+,39-,40-,41-,42-,44+,45+,46-,47-,48-,49-/m0/s1 |
| InChI Key | MZYZCUCXNWCJKE-XBFYRACCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C59H80BrN9O18 |
| Molecular Weight | 1283.20 g/mol |
| Exact Mass | 1281.48047 g/mol |
| Topological Polar Surface Area (TPSA) | 412.00 Ų |
| XlogP | 3.30 |
| Atomic LogP (AlogP) | -1.08 |
| H-Bond Acceptor | 18 |
| H-Bond Donor | 14 |
| Rotatable Bonds | 20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.7339 | 73.39% |
| Caco-2 | - | 0.8640 | 86.40% |
| Blood Brain Barrier | - | 0.9250 | 92.50% |
| Human oral bioavailability | - | 0.6286 | 62.86% |
| Subcellular localzation | Nucleus | 0.4662 | 46.62% |
| OATP2B1 inhibitior | - | 0.8599 | 85.99% |
| OATP1B1 inhibitior | + | 0.8211 | 82.11% |
| OATP1B3 inhibitior | + | 0.9278 | 92.78% |
| MATE1 inhibitior | - | 0.8200 | 82.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.9047 | 90.47% |
| P-glycoprotein inhibitior | + | 0.7417 | 74.17% |
| P-glycoprotein substrate | + | 0.8848 | 88.48% |
| CYP3A4 substrate | + | 0.7461 | 74.61% |
| CYP2C9 substrate | - | 0.8016 | 80.16% |
| CYP2D6 substrate | - | 0.8409 | 84.09% |
| CYP3A4 inhibition | - | 0.8981 | 89.81% |
| CYP2C9 inhibition | - | 0.8545 | 85.45% |
| CYP2C19 inhibition | - | 0.8599 | 85.99% |
| CYP2D6 inhibition | - | 0.8882 | 88.82% |
| CYP1A2 inhibition | - | 0.8832 | 88.32% |
| CYP2C8 inhibition | + | 0.7878 | 78.78% |
| CYP inhibitory promiscuity | - | 0.9184 | 91.84% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.7600 | 76.00% |
| Carcinogenicity (trinary) | Non-required | 0.5772 | 57.72% |
| Eye corrosion | - | 0.9863 | 98.63% |
| Eye irritation | - | 0.8967 | 89.67% |
| Skin irritation | - | 0.7852 | 78.52% |
| Skin corrosion | - | 0.9335 | 93.35% |
| Ames mutagenesis | - | 0.5254 | 52.54% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7152 | 71.52% |
| Micronuclear | + | 0.8900 | 89.00% |
| Hepatotoxicity | - | 0.5840 | 58.40% |
| skin sensitisation | - | 0.8669 | 86.69% |
| Respiratory toxicity | + | 0.8667 | 86.67% |
| Reproductive toxicity | + | 0.9000 | 90.00% |
| Mitochondrial toxicity | + | 0.9125 | 91.25% |
| Nephrotoxicity | - | 0.8084 | 80.84% |
| Acute Oral Toxicity (c) | III | 0.6188 | 61.88% |
| Estrogen receptor binding | + | 0.6768 | 67.68% |
| Androgen receptor binding | + | 0.7522 | 75.22% |
| Thyroid receptor binding | + | 0.7116 | 71.16% |
| Glucocorticoid receptor binding | + | 0.7349 | 73.49% |
| Aromatase binding | + | 0.6771 | 67.71% |
| PPAR gamma | + | 0.8037 | 80.37% |
| Honey bee toxicity | - | 0.6780 | 67.80% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
| Fish aquatic toxicity | + | 0.7507 | 75.07% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.92% | 98.95% |
| CHEMBL4072 | P07858 | Cathepsin B | 99.80% | 93.67% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 99.20% | 90.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.50% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.29% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.72% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.60% | 83.82% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 97.47% | 95.93% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 96.71% | 85.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.30% | 99.17% |
| CHEMBL3837 | P07711 | Cathepsin L | 96.01% | 96.61% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.94% | 98.05% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 95.38% | 92.88% |
| CHEMBL236 | P41143 | Delta opioid receptor | 95.33% | 99.35% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.13% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.21% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.02% | 93.56% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 93.70% | 96.38% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 93.60% | 94.66% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.05% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.75% | 95.89% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 92.14% | 97.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.35% | 95.89% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 90.91% | 90.93% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 90.72% | 93.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.47% | 94.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.27% | 90.71% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 90.12% | 100.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.92% | 98.59% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 89.75% | 95.34% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 89.64% | 96.31% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.43% | 91.19% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.38% | 97.14% |
| CHEMBL1949 | P62937 | Cyclophilin A | 89.26% | 98.57% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.23% | 96.90% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.82% | 82.38% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 88.58% | 100.00% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 88.52% | 89.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.44% | 99.15% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.97% | 93.03% |
| CHEMBL2000 | P03952 | Plasma kallikrein | 86.75% | 93.92% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 86.70% | 96.37% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.84% | 89.50% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 84.57% | 97.29% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.55% | 88.56% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 84.26% | 97.64% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 84.14% | 95.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.82% | 100.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.67% | 100.00% |
| CHEMBL3776 | Q14790 | Caspase-8 | 81.55% | 97.06% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.70% | 91.24% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.48% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139586661 |
| LOTUS | LTS0076076 |
| wikiData | Q77511536 |