(1R,2S,4S,6R,9R,10S,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-2,6-diol
| Internal ID | 0d8738cd-d677-4bed-a63c-46b23a449ea8 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | (1R,2S,4S,6R,9R,10S,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-2,6-diol |
| SMILES (Canonical) | CC1(C(CCC2(C1CC(C34C2CCC(C3)C(=C)C4)O)C)O)C |
| SMILES (Isomeric) | C[C@@]12CC[C@H](C([C@H]1C[C@@H]([C@]34[C@H]2CC[C@H](C3)C(=C)C4)O)(C)C)O |
| InChI | InChI=1S/C20H32O2/c1-12-10-20-11-13(12)5-6-14(20)19(4)8-7-16(21)18(2,3)15(19)9-17(20)22/h13-17,21-22H,1,5-11H2,2-4H3/t13-,14+,15-,16-,17+,19+,20+/m1/s1 |
| InChI Key | BPIAVHDTDZOEES-IFWNTPBBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.240230259 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
![2D Structure of (1R,2S,4S,6R,9R,10S,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-2,6-diol](https://plantaedb.com/storage/docs/compounds/2023/11/e6b521d0-864f-11ee-bb08-639e4d6e77cb.jpg "2D Structure of (1R,2S,4S,6R,9R,10S,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-2,6-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.25% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.53% | 97.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.84% | 82.69% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.86% | 90.17% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.07% | 95.58% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.90% | 96.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.63% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.56% | 91.11% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.96% | 95.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.74% | 95.93% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.58% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.43% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.50% | 94.75% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.24% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sideritis perfoliata subsp. athoa |
| PubChem | 162896901 |
| LOTUS | LTS0127004 |
| wikiData | Q104942321 |