[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromenylium-7-yl]oxyoxan-2-yl]methyl 4-hydroxybenzoate
Internal ID | d4a7addc-831e-4358-a2c4-309cb3198696 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanins > Anthocyanidin-7-O-Glycosides |
IUPAC Name | [(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromenylium-7-yl]oxyoxan-2-yl]methyl 4-hydroxybenzoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC4=C(C=C(C=C4[O+]=C3C5=CC=C(C=C5)O)OC6C(C(C(C(O6)COC(=O)C7=CC=C(C=C7)O)O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC4=C(C=C(C=C4[O+]=C3C5=CC=C(C=C5)O)O[C@H]6[C@H]([C@H]([C@@H]([C@@H](O6)COC(=O)C7=CC=C(C=C7)O)O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C40H44O21/c1-15-27(44)30(47)33(50)38(56-15)55-14-26-29(46)32(49)35(52)40(61-26)59-24-12-21-22(43)10-20(11-23(21)58-36(24)16-2-6-18(41)7-3-16)57-39-34(51)31(48)28(45)25(60-39)13-54-37(53)17-4-8-19(42)9-5-17/h2-12,15,25-35,38-40,44-52H,13-14H2,1H3,(H2-,41,42,43,53)/p+1/t15-,25-,26+,27-,28+,29+,30+,31-,32-,33-,34-,35+,38+,39+,40+/m0/s1 |
InChI Key | ITPPMHAGKJUWHT-RVBXKLAGSA-O |
Popularity | 0 references in papers |
Molecular Formula | C40H45O21+ |
Molecular Weight | 861.80 g/mol |
Exact Mass | 861.24533344 g/mol |
Topological Polar Surface Area (TPSA) | 325.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of [(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromenylium-7-yl]oxyoxan-2-yl]methyl 4-hydroxybenzoate 2D Structure of [(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromenylium-7-yl]oxyoxan-2-yl]methyl 4-hydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/e6b32c80-8590-11ee-b49f-1fea1008ddb3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.38% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.31% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.93% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.95% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.77% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.38% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.19% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.15% | 99.17% |
CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 89.91% | 96.69% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.25% | 95.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.91% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.84% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.62% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 84.17% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.65% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.06% | 95.83% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.47% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.40% | 92.94% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.39% | 83.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.41% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Delphinium schmalhausenii |
PubChem | 163188036 |
LOTUS | LTS0077838 |
wikiData | Q105120216 |