(1R,7S,9R,11R,13R,14R,17S)-14-hydroxy-11-methyl-17-oxido-2-aza-17-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-3-one
Internal ID | d352f19b-49d9-4421-9c69-b1600e74898d |
Taxonomy | Organoheterocyclic compounds > Quinolizidines |
IUPAC Name | (1R,7S,9R,11R,13R,14R,17S)-14-hydroxy-11-methyl-17-oxido-2-aza-17-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-3-one |
SMILES (Canonical) | CC1CC2CC3CCCC(=O)N3C4[N+]2(C(C1)C(CC4)O)[O-] |
SMILES (Isomeric) | C[C@@H]1C[C@@H]2C[C@@H]3CCCC(=O)N3[C@@H]4[N@+]2([C@H](C1)[C@@H](CC4)O)[O-] |
InChI | InChI=1S/C16H26N2O3/c1-10-7-12-9-11-3-2-4-16(20)17(11)15-6-5-14(19)13(8-10)18(12,15)21/h10-15,19H,2-9H2,1H3/t10-,11+,12-,13-,14-,15-,18+/m1/s1 |
InChI Key | BIDUKOSIGHDYCM-MPIXCSOCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H26N2O3 |
Molecular Weight | 294.39 g/mol |
Exact Mass | 294.19434270 g/mol |
Topological Polar Surface Area (TPSA) | 58.60 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of (1R,7S,9R,11R,13R,14R,17S)-14-hydroxy-11-methyl-17-oxido-2-aza-17-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-3-one 2D Structure of (1R,7S,9R,11R,13R,14R,17S)-14-hydroxy-11-methyl-17-oxido-2-aza-17-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/e66a4320-85c9-11ee-a4c9-87a60f62cb8c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 93.36% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.52% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.22% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.81% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.54% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.54% | 96.77% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 86.21% | 98.46% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.76% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.71% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.79% | 91.19% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.69% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.73% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.70% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.02% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lycopodiella cernua |
PubChem | 163014310 |
LOTUS | LTS0134117 |
wikiData | Q105100720 |