[(1S,3R,6S,8S,11R,12S,15R,16R)-15-[(2S,5R)-5,6-dimethylhept-6-en-2-yl]-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate
Internal ID | 7ac03559-5d31-4f3d-a58b-1aed337d2819 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | [(1S,3R,6S,8S,11R,12S,15R,16R)-15-[(2S,5R)-5,6-dimethylhept-6-en-2-yl]-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
SMILES (Canonical) | CC(CCC(C)C(=C)C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)OC(=O)C)C)C |
SMILES (Isomeric) | C[C@@H](CC[C@@H](C)C(=C)C)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@@H]2CC[C@H]5[C@]3(C4)CC[C@@H](C5(C)C)OC(=O)C)C)C |
InChI | InChI=1S/C33H54O2/c1-21(2)22(3)10-11-23(4)25-14-16-31(9)27-13-12-26-29(6,7)28(35-24(5)34)15-17-32(26)20-33(27,32)19-18-30(25,31)8/h22-23,25-28H,1,10-20H2,2-9H3/t22-,23+,25-,26-,27-,28+,30-,31+,32-,33+/m1/s1 |
InChI Key | XANCISIMFMVUPX-CAVXGYIDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H54O2 |
Molecular Weight | 482.80 g/mol |
Exact Mass | 482.412380961 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 11.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.44% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.13% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.66% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.26% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.03% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.47% | 91.19% |
CHEMBL233 | P35372 | Mu opioid receptor | 88.76% | 97.93% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.40% | 83.82% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.16% | 93.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 87.00% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.20% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.00% | 82.69% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.64% | 96.95% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.80% | 89.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.74% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.42% | 95.89% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.39% | 94.78% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.24% | 100.00% |
CHEMBL236 | P41143 | Delta opioid receptor | 82.23% | 99.35% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.02% | 95.71% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.70% | 97.47% |
CHEMBL3837 | P07711 | Cathepsin L | 81.32% | 96.61% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.45% | 82.50% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.42% | 96.47% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.34% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polypodium vulgare |
PubChem | 162917069 |
LOTUS | LTS0110970 |
wikiData | Q105324001 |