N-[(2S,3R,4S,5S,8S,9R)-9-methyl-9-(trimethylsilylmethoxy)-1,3,4,5,8-pentakis(trimethylsilyloxy)octadecan-2-yl]acetamide
| Internal ID | 5138a716-d37b-4a10-83d2-4a5bd8dcefdb |
| Taxonomy | Organometallic compounds > Organometalloid compounds > Organosilicon compounds > Organoheterosilanes > Trialkylheterosilanes |
| IUPAC Name | N-[(2S,3R,4S,5S,8S,9R)-9-methyl-9-(trimethylsilylmethoxy)-1,3,4,5,8-pentakis(trimethylsilyloxy)octadecan-2-yl]acetamide |
| SMILES (Canonical) | CCCCCCCCCC(C)(C(CCC(C(C(C(CO[Si](C)(C)C)NC(=O)C)O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)OC[Si](C)(C)C |
| SMILES (Isomeric) | CCCCCCCCC[C@](C)([C@H](CC[C@@H]([C@@H]([C@@H]([C@H](CO[Si](C)(C)C)NC(=O)C)O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)OC[Si](C)(C)C |
| InChI | InChI=1S/C40H93NO7Si6/c1-22-23-24-25-26-27-28-31-40(3,43-33-49(4,5)6)37(46-52(13,14)15)30-29-36(45-51(10,11)12)39(48-54(19,20)21)38(47-53(16,17)18)35(41-34(2)42)32-44-50(7,8)9/h35-39H,22-33H2,1-21H3,(H,41,42)/t35-,36-,37-,38+,39-,40+/m0/s1 |
| InChI Key | SOTYPNYMOXVXKT-AKUVXLQWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H93NO7Si6 |
| Molecular Weight | 868.70 g/mol |
| Exact Mass | 867.55676351 g/mol |
| Topological Polar Surface Area (TPSA) | 84.50 Ų |
| XlogP | 0.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.87% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.56% | 99.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.65% | 97.29% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.45% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.62% | 94.73% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.80% | 93.56% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 90.65% | 92.29% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.42% | 92.86% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.97% | 89.63% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.77% | 100.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.60% | 97.21% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.24% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.92% | 94.45% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 86.41% | 91.81% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.94% | 95.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.79% | 83.82% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.29% | 96.90% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.71% | 94.33% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.52% | 97.79% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.62% | 97.25% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.42% | 90.17% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.24% | 92.08% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.11% | 89.34% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.09% | 100.00% |
| CHEMBL5028 | O14672 | ADAM10 | 80.47% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162870109 |
| LOTUS | LTS0222405 |
| wikiData | Q105257198 |