[(1S,2R,3R,5R,9R,10R,11S)-10-hydroxy-5,9-dimethyl-14-methylidene-13-oxo-4,12-dioxatricyclo[9.3.0.03,5]tetradecan-2-yl] 3-methylbut-2-enoate
Internal ID | 3b3321e1-6613-4758-9506-ee120bb5145c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [(1S,2R,3R,5R,9R,10R,11S)-10-hydroxy-5,9-dimethyl-14-methylidene-13-oxo-4,12-dioxatricyclo[9.3.0.03,5]tetradecan-2-yl] 3-methylbut-2-enoate |
SMILES (Canonical) | CC1CCCC2(C(O2)C(C3C(C1O)OC(=O)C3=C)OC(=O)C=C(C)C)C |
SMILES (Isomeric) | C[C@@H]1CCC[C@@]2([C@H](O2)[C@@H]([C@@H]3[C@@H]([C@@H]1O)OC(=O)C3=C)OC(=O)C=C(C)C)C |
InChI | InChI=1S/C20H28O6/c1-10(2)9-13(21)24-17-14-12(4)19(23)25-16(14)15(22)11(3)7-6-8-20(5)18(17)26-20/h9,11,14-18,22H,4,6-8H2,1-3,5H3/t11-,14+,15-,16+,17-,18-,20-/m1/s1 |
InChI Key | UMHQHFHQQZZQGN-LKEAYODTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O6 |
Molecular Weight | 364.40 g/mol |
Exact Mass | 364.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 85.40 Ų |
XlogP | 3.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.30% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.33% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 88.72% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.38% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.36% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.97% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.38% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.87% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.35% | 97.14% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.90% | 97.05% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.29% | 92.94% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.48% | 90.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.39% | 92.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.73% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.24% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.39% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.68% | 93.03% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.52% | 91.19% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.07% | 91.07% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.55% | 85.14% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.01% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Blumea balsamifera |
PubChem | 162856598 |
LOTUS | LTS0036516 |
wikiData | Q105275559 |