(E,4R)-2-methyl-4-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]-4-(2,6,6-trimethylcyclohexen-1-yl)but-2-enal
| Internal ID | 482760fa-790b-4001-90e1-5aa1419d5d55 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | (E,4R)-2-methyl-4-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]-4-(2,6,6-trimethylcyclohexen-1-yl)but-2-enal |
| SMILES (Canonical) | CC1=C(C(CCC1)(C)C)C(C=C(C)C=O)C2C=C(C(=O)O2)C |
| SMILES (Isomeric) | CC1=C(C(CCC1)(C)C)[C@@H](/C=C(\C)/C=O)[C@H]2C=C(C(=O)O2)C |
| InChI | InChI=1S/C19H26O3/c1-12(11-20)9-15(16-10-14(3)18(21)22-16)17-13(2)7-6-8-19(17,4)5/h9-11,15-16H,6-8H2,1-5H3/b12-9+/t15-,16+/m0/s1 |
| InChI Key | VIJGCIHLYOSADX-HUXQLNKYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.18819469 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
![2D Structure of (E,4R)-2-methyl-4-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]-4-(2,6,6-trimethylcyclohexen-1-yl)but-2-enal](https://plantaedb.com/storage/docs/compounds/2023/11/e4r-2-methyl-4-2r-4-methyl-5-oxo-2h-furan-2-yl-4-266-trimethylcyclohexen-1-ylbut-2-enal.jpg "2D Structure of (E,4R)-2-methyl-4-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]-4-(2,6,6-trimethylcyclohexen-1-yl)but-2-enal")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.93% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.49% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.69% | 95.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.42% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.16% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.78% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.57% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.47% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.19% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.72% | 94.45% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.69% | 88.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.06% | 94.73% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.83% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.10% | 95.89% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.09% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pellia epiphylla |
| PubChem | 101938880 |
| LOTUS | LTS0063119 |
| wikiData | Q105286853 |