methyl (4aS,6aS,6aS,6bR,8aS,10R,11S,12aR,14bS)-10,11-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Internal ID | 4b436eb7-30f7-4f9f-8c25-a0214c9507fe |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | methyl (4aS,6aS,6aS,6bR,8aS,10R,11S,12aR,14bS)-10,11-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)C)O)O)C)C)C2C1)C)C(=O)OC)C |
SMILES (Isomeric) | C[C@@]12CC[C@H]3[C@@]([C@@H]1CC=C4[C@]2(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)OC)C)(C[C@@H]([C@@H](C3(C)C)O)O)C |
InChI | InChI=1S/C31H50O4/c1-26(2)13-15-31(25(34)35-8)16-14-29(6)19(20(31)17-26)9-10-23-28(5)18-21(32)24(33)27(3,4)22(28)11-12-30(23,29)7/h9,20-24,32-33H,10-18H2,1-8H3/t20-,21-,22+,23-,24-,28-,29+,30+,31-/m0/s1 |
InChI Key | OTDUGESKRJHFHR-UEIGOQARSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H50O4 |
Molecular Weight | 486.70 g/mol |
Exact Mass | 486.37091007 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 6.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.22% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.19% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.31% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.25% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.74% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.06% | 82.69% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.85% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.79% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.67% | 90.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.50% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.23% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.54% | 91.07% |
CHEMBL2581 | P07339 | Cathepsin D | 84.24% | 98.95% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.60% | 95.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.97% | 100.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.05% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melissa officinalis |
PubChem | 162953520 |
LOTUS | LTS0129318 |
wikiData | Q105199515 |