24-Hydroxy-4,6,7,9,13,15-hexamethyl-18,26-dioxa-28-azaoctacyclo[22.2.2.219,22.13,10.01,25.04,8.011,16.017,31]hentriaconta-5,8,19(30),20,22(29)-pentaene-2,27-dione
| Internal ID | 2f43120b-8e78-42ee-8fd7-9472f675faff |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Eicosanoids > Prostaglandins and related compounds |
| IUPAC Name | 24-hydroxy-4,6,7,9,13,15-hexamethyl-18,26-dioxa-28-azaoctacyclo[22.2.2.219,22.13,10.01,25.04,8.011,16.017,31]hentriaconta-5,8,19(30),20,22(29)-pentaene-2,27-dione |
| SMILES (Canonical) | CC1CC(C2C(C1)C3C4C2OC5=CC=C(CC6(C7C(O7)(C(=O)C4C8(C=C(C(C8=C3C)C)C)C)C(=O)N6)O)C=C5)C |
| SMILES (Isomeric) | CC1CC(C2C(C1)C3C4C2OC5=CC=C(CC6(C7C(O7)(C(=O)C4C8(C=C(C(C8=C3C)C)C)C)C(=O)N6)O)C=C5)C |
| InChI | InChI=1S/C34H41NO5/c1-15-11-16(2)23-22(12-15)24-19(5)26-18(4)17(3)13-32(26,6)27-25(24)28(23)39-21-9-7-20(8-10-21)14-33(38)30-34(40-30,29(27)36)31(37)35-33/h7-10,13,15-16,18,22-25,27-28,30,38H,11-12,14H2,1-6H3,(H,35,37) |
| InChI Key | NQFJAFJMOUIAAX-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C34H41NO5 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.29847341 g/mol |
| Topological Polar Surface Area (TPSA) | 88.20 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
![2D Structure of 24-Hydroxy-4,6,7,9,13,15-hexamethyl-18,26-dioxa-28-azaoctacyclo[22.2.2.219,22.13,10.01,25.04,8.011,16.017,31]hentriaconta-5,8,19(30),20,22(29)-pentaene-2,27-dione](https://plantaedb.com/storage/docs/compounds/2023/11/e4b26da0-85bd-11ee-b573-a5e9c20971b8.jpg "2D Structure of 24-Hydroxy-4,6,7,9,13,15-hexamethyl-18,26-dioxa-28-azaoctacyclo[22.2.2.219,22.13,10.01,25.04,8.011,16.017,31]hentriaconta-5,8,19(30),20,22(29)-pentaene-2,27-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.51% | 94.45% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.44% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.40% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.31% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.20% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.78% | 96.09% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 88.10% | 97.33% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 87.37% | 86.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.17% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.56% | 99.23% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.18% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.54% | 98.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.42% | 90.24% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.24% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.34% | 97.25% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.04% | 90.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.89% | 92.94% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.41% | 92.88% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.62% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.61% | 95.89% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.58% | 97.79% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 80.50% | 95.48% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162981765 |
| LOTUS | LTS0099488 |
| wikiData | Q104179899 |