[(1S,4aS,7R,7aS)-7-(acetyloxymethyl)-7-hydroxy-4-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-[[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxan-2-yl]oxymethyl]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate
Internal ID | ce339a07-9ee6-4058-8d8a-8a7f47e43af5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | [(1S,4aS,7R,7aS)-7-(acetyloxymethyl)-7-hydroxy-4-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-[[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxan-2-yl]oxymethyl]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate |
SMILES (Canonical) | CC(C)CC(=O)OC1C2C(CCC2(COC(=O)C)O)C(=CO1)COC3C(C(C(C(O3)COC(=O)C=CC4=CC=C(C=C4)O)O)O)O |
SMILES (Isomeric) | CC(C)CC(=O)O[C@H]1[C@H]2[C@H](CC[C@@]2(COC(=O)C)O)C(=CO1)CO[C@H]3[C@H]([C@@H]([C@@H]([C@@H](O3)COC(=O)/C=C\C4=CC=C(C=C4)O)O)O)O |
InChI | InChI=1S/C32H42O14/c1-17(2)12-25(36)46-30-26-22(10-11-32(26,40)16-44-18(3)33)20(13-42-30)14-43-31-29(39)28(38)27(37)23(45-31)15-41-24(35)9-6-19-4-7-21(34)8-5-19/h4-9,13,17,22-23,26-31,34,37-40H,10-12,14-16H2,1-3H3/b9-6-/t22-,23+,26-,27-,28-,29+,30+,31-,32+/m1/s1 |
InChI Key | USYGRXORRSAVFG-LRVORNTESA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H42O14 |
Molecular Weight | 650.70 g/mol |
Exact Mass | 650.25745601 g/mol |
Topological Polar Surface Area (TPSA) | 208.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.08% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.34% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.43% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.47% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.01% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.27% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.93% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.69% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.65% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.23% | 95.89% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.05% | 94.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.76% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.43% | 100.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.53% | 89.67% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 85.89% | 97.64% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.73% | 100.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.63% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.62% | 95.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.49% | 92.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.66% | 90.17% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.26% | 97.21% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.82% | 94.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.99% | 94.80% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.22% | 97.25% |
CHEMBL5028 | O14672 | ADAM10 | 81.86% | 97.50% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 81.49% | 98.35% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.23% | 85.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.93% | 94.23% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.55% | 93.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.30% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Viburnum furcatum |
PubChem | 162983511 |
LOTUS | LTS0233980 |
wikiData | Q105278583 |