(1S,10S,22R,23R,24S)-15-hydroxy-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,14(19),15,17-tetraene-12,20-dione
Internal ID | eafbf237-1b78-4503-8ec1-3e03f14c1e23 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | (1S,10S,22R,23R,24S)-15-hydroxy-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,14(19),15,17-tetraene-12,20-dione |
SMILES (Canonical) | C1CNCC2=CCOC3CC(=O)N4C5C3C2CC(=O)C51C6=C4C(=CC=C6)O |
SMILES (Isomeric) | C1CNCC2=CCO[C@H]3CC(=O)N4[C@H]5[C@H]3[C@H]2CC(=O)[C@@]51C6=C4C(=CC=C6)O |
InChI | InChI=1S/C21H22N2O4/c24-14-3-1-2-13-19(14)23-17(26)9-15-18-12-8-16(25)21(13,20(18)23)5-6-22-10-11(12)4-7-27-15/h1-4,12,15,18,20,22,24H,5-10H2/t12-,15-,18-,20-,21+/m0/s1 |
InChI Key | WKECTJXZMZMDBI-YGWJJUHZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22N2O4 |
Molecular Weight | 366.40 g/mol |
Exact Mass | 366.15795719 g/mol |
Topological Polar Surface Area (TPSA) | 78.90 Ų |
XlogP | -0.50 |
There are no found synonyms. |
![2D Structure of (1S,10S,22R,23R,24S)-15-hydroxy-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,14(19),15,17-tetraene-12,20-dione 2D Structure of (1S,10S,22R,23R,24S)-15-hydroxy-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,14(19),15,17-tetraene-12,20-dione](https://plantaedb.com/storage/docs/compounds/2023/11/e483df40-850b-11ee-a422-d5b7ee13b07c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.10% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 95.06% | 99.23% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.53% | 94.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.37% | 91.11% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 92.55% | 96.39% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.88% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.75% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 90.93% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.92% | 95.56% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 90.48% | 93.03% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.33% | 94.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.03% | 93.99% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.99% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.68% | 94.45% |
CHEMBL204 | P00734 | Thrombin | 87.67% | 96.01% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.30% | 99.15% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.86% | 93.40% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.20% | 85.11% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 81.69% | 98.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.43% | 95.89% |
CHEMBL228 | P31645 | Serotonin transporter | 81.39% | 95.51% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos icaja |
PubChem | 162852573 |
LOTUS | LTS0263288 |
wikiData | Q105307272 |