[(2R,3R,4S,5S,6S)-3-acetyloxy-2-[(1R,2E,6E,10S)-3,7-dimethyl-10-propan-2-ylcyclodeca-2,6-dien-1-yl]oxy-5-hydroxy-6-methyloxan-4-yl] 3-methylbut-2-enoate
| Internal ID | b2e51bc9-7db4-4a86-81ce-6b40722692d9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3-acetyloxy-2-[(1R,2E,6E,10S)-3,7-dimethyl-10-propan-2-ylcyclodeca-2,6-dien-1-yl]oxy-5-hydroxy-6-methyloxan-4-yl] 3-methylbut-2-enoate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C=C(CCC=C(CCC2C(C)C)C)C)OC(=O)C)OC(=O)C=C(C)C)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@H]2/C=C(/CC/C=C(/CC[C@H]2C(C)C)\C)\C)OC(=O)C)OC(=O)C=C(C)C)O |
| InChI | InChI=1S/C28H44O7/c1-16(2)14-24(30)35-26-25(31)20(7)32-28(27(26)33-21(8)29)34-23-15-19(6)11-9-10-18(5)12-13-22(23)17(3)4/h10,14-15,17,20,22-23,25-28,31H,9,11-13H2,1-8H3/b18-10+,19-15+/t20-,22-,23-,25-,26-,27+,28-/m0/s1 |
| InChI Key | COMHCGXHNIPZAB-LFSDPJRISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H44O7 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.30870374 g/mol |
| Topological Polar Surface Area (TPSA) | 91.30 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.88% | 91.11% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 95.58% | 95.89% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.58% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.37% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.24% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.86% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.56% | 94.73% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.41% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.23% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.17% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.01% | 94.45% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.42% | 92.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.78% | 90.00% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.19% | 97.47% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.42% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.00% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pittosporum tobira |
| PubChem | 162939216 |
| LOTUS | LTS0074615 |
| wikiData | Q104967151 |