(12R,25R)-4,5,20,31-tetramethoxy-11,26-dimethyl-2,18-dioxa-11,26-diazaheptacyclo[23.6.2.214,17.119,23.03,8.07,12.029,33]hexatriaconta-1(31),3(8),4,6,14(36),15,17(35),19,21,23(34),29,32-dodecaene
Internal ID | e41efc46-4214-40b4-9105-74d193c2a3b8 |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | (12R,25R)-4,5,20,31-tetramethoxy-11,26-dimethyl-2,18-dioxa-11,26-diazaheptacyclo[23.6.2.214,17.119,23.03,8.07,12.029,33]hexatriaconta-1(31),3(8),4,6,14(36),15,17(35),19,21,23(34),29,32-dodecaene |
SMILES (Canonical) | CN1CCC2=CC(=C3C=C2C1CC4=CC(=C(C=C4)OC)OC5=CC=C(CC6C7=CC(=C(C(=C7CCN6C)O3)OC)OC)C=C5)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C3C=C2[C@H]1CC4=CC(=C(C=C4)OC)OC5=CC=C(C[C@@H]6C7=CC(=C(C(=C7CCN6C)O3)OC)OC)C=C5)OC |
InChI | InChI=1S/C38H42N2O6/c1-39-15-13-25-20-33(42-4)35-21-28(25)30(39)18-24-9-12-32(41-3)34(19-24)45-26-10-7-23(8-11-26)17-31-29-22-36(43-5)38(44-6)37(46-35)27(29)14-16-40(31)2/h7-12,19-22,30-31H,13-18H2,1-6H3/t30-,31-/m1/s1 |
InChI Key | KAZMVDUIJWJXEO-FIRIVFDPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H42N2O6 |
Molecular Weight | 622.70 g/mol |
Exact Mass | 622.30428706 g/mol |
Topological Polar Surface Area (TPSA) | 61.90 Ų |
XlogP | 6.70 |
There are no found synonyms. |
![2D Structure of (12R,25R)-4,5,20,31-tetramethoxy-11,26-dimethyl-2,18-dioxa-11,26-diazaheptacyclo[23.6.2.214,17.119,23.03,8.07,12.029,33]hexatriaconta-1(31),3(8),4,6,14(36),15,17(35),19,21,23(34),29,32-dodecaene 2D Structure of (12R,25R)-4,5,20,31-tetramethoxy-11,26-dimethyl-2,18-dioxa-11,26-diazaheptacyclo[23.6.2.214,17.119,23.03,8.07,12.029,33]hexatriaconta-1(31),3(8),4,6,14(36),15,17(35),19,21,23(34),29,32-dodecaene](https://plantaedb.com/storage/docs/compounds/2023/11/e47e9980-8504-11ee-8afe-f15504dad22b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.31% | 96.09% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.30% | 91.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 93.35% | 92.98% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.24% | 93.99% |
CHEMBL5747 | Q92793 | CREB-binding protein | 92.87% | 95.12% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.95% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.49% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 89.36% | 98.75% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 88.82% | 95.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.92% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.87% | 94.45% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 86.60% | 82.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.32% | 95.89% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.21% | 89.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.81% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.53% | 85.14% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.52% | 95.78% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 84.31% | 90.95% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 84.06% | 95.53% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.04% | 89.50% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.61% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.44% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.70% | 89.00% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 82.11% | 92.38% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 81.73% | 97.31% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.06% | 82.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Thalictrum sultanabadense |
PubChem | 162925359 |
LOTUS | LTS0184018 |
wikiData | Q105175149 |