1-(4,7-Dihydroxy-10-methoxy-6,15-dioxatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,8(13),9,11-hexaen-2-yl)ethanone
| Internal ID | 6bb41074-b22e-4d94-98aa-929624540a87 |
| Taxonomy | Organoheterocyclic compounds > Benzofurans > Dibenzofurans |
| IUPAC Name | 1-(4,7-dihydroxy-10-methoxy-6,15-dioxatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,8(13),9,11-hexaen-2-yl)ethanone |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H12O6/c1-6(17)8-5-10(18)15-13-12-9(16(19)22-15)3-7(20-2)4-11(12)21-14(8)13/h3-5,16,18-19H,1-2H3 |
| InChI Key | LDYUGSMSWWYPGX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 89.10 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
![2D Structure of 1-(4,7-Dihydroxy-10-methoxy-6,15-dioxatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,8(13),9,11-hexaen-2-yl)ethanone](https://plantaedb.com/storage/docs/compounds/2023/11/e46ba9a0-8729-11ee-af82-11d70fb4ffde.jpg "2D Structure of 1-(4,7-Dihydroxy-10-methoxy-6,15-dioxatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,8(13),9,11-hexaen-2-yl)ethanone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.66% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.96% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.06% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.12% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.85% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.83% | 99.23% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.09% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.02% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.20% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.07% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.50% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.19% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.53% | 98.95% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.06% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162958477 |
| LOTUS | LTS0074129 |
| wikiData | Q104170857 |