3-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-7-methoxy-2-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one
Internal ID | 51ae88cb-c7b2-4031-982c-cbe526882a63 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-7-methoxy-2-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=C(OC4=CC(=CC(=C4C3=O)O)OC)C5=CC=C(C=C5)OC6C(C(C(C(O6)CO)O)O)O)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)O[C@@H]2[C@H]([C@H]([C@H](O[C@H]2OC3=C(OC4=CC(=CC(=C4C3=O)O)OC)C5=CC=C(C=C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O)O)O)CO)O)O)O)O)O |
InChI | InChI=1S/C34H42O20/c1-11-20(38)24(42)27(45)32(48-11)54-31-26(44)22(40)18(10-36)52-34(31)53-30-23(41)19-15(37)7-14(47-2)8-16(19)50-29(30)12-3-5-13(6-4-12)49-33-28(46)25(43)21(39)17(9-35)51-33/h3-8,11,17-18,20-22,24-28,31-40,42-46H,9-10H2,1-2H3/t11-,17+,18+,20-,21-,22-,24+,25-,26-,27-,28+,31+,32-,33+,34-/m0/s1 |
InChI Key | COQHRDFLJUXFJY-QEJUJVCISA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H42O20 |
Molecular Weight | 770.70 g/mol |
Exact Mass | 770.22694372 g/mol |
Topological Polar Surface Area (TPSA) | 313.00 Ų |
XlogP | -1.90 |
There are no found synonyms. |
![2D Structure of 3-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-7-methoxy-2-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one 2D Structure of 3-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-7-methoxy-2-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/e420af50-87d2-11ee-b655-5ba8628edb19.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.54% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.48% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.29% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.22% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.76% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.27% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.11% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.76% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.38% | 96.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.43% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.58% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.98% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.70% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.63% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.47% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.70% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.68% | 96.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.11% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cadaba glandulosa |
PubChem | 163031095 |
LOTUS | LTS0036909 |
wikiData | Q104967222 |