(2S,3R,4S,5S,6R)-2-[[(5S,8R)-1-hydroxy-5-[(2R)-1-hydroxypropan-2-yl]-3,8-dimethyl-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol
Internal ID | d741baf7-f9cc-455a-9509-234410595cc2 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[[(5S,8R)-1-hydroxy-5-[(2R)-1-hydroxypropan-2-yl]-3,8-dimethyl-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC(C2=C1C(=C(C(=C2)C)OC3C(C(C(C(O3)COC4C(C(C(CO4)O)O)O)O)O)O)O)C(C)CO |
SMILES (Isomeric) | C[C@@H]1CC[C@H](C2=C1C(=C(C(=C2)C)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO[C@H]4[C@@H]([C@H]([C@@H](CO4)O)O)O)O)O)O)O)[C@@H](C)CO |
InChI | InChI=1S/C26H40O12/c1-10-4-5-13(12(3)7-27)14-6-11(2)24(20(31)17(10)14)38-26-23(34)21(32)19(30)16(37-26)9-36-25-22(33)18(29)15(28)8-35-25/h6,10,12-13,15-16,18-19,21-23,25-34H,4-5,7-9H2,1-3H3/t10-,12+,13+,15-,16-,18+,19-,21+,22-,23-,25+,26+/m1/s1 |
InChI Key | XJVQGOKRTPWSGD-MFRJEYCMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H40O12 |
Molecular Weight | 544.60 g/mol |
Exact Mass | 544.25197671 g/mol |
Topological Polar Surface Area (TPSA) | 199.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.67% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.87% | 98.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 95.71% | 89.62% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.70% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.33% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.75% | 97.25% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 89.70% | 93.18% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.96% | 95.93% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.60% | 83.57% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.39% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.24% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.88% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.68% | 90.71% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 84.14% | 80.33% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.70% | 86.33% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.60% | 90.24% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.25% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.57% | 94.73% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.33% | 95.83% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.00% | 93.56% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.71% | 83.82% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.39% | 99.15% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.11% | 95.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alangium premnifolium |
PubChem | 162975955 |
LOTUS | LTS0090336 |
wikiData | Q105329246 |