[(1S,3S,4S,4aR,8aR)-3,4-dihydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-yl] (E)-3-phenylprop-2-enoate
Internal ID | 783fcf5f-3cce-4a88-b579-5c7a6305afc6 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
IUPAC Name | [(1S,3S,4S,4aR,8aR)-3,4-dihydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-yl] (E)-3-phenylprop-2-enoate |
SMILES (Canonical) | CC(C)C1=CC2C(CC1)(C(C(CC2(C)OC(=O)C=CC3=CC=CC=C3)O)O)C |
SMILES (Isomeric) | CC(C)C1=C[C@@H]2[C@@](CC1)([C@@H]([C@H](C[C@]2(C)OC(=O)/C=C/C3=CC=CC=C3)O)O)C |
InChI | InChI=1S/C24H32O4/c1-16(2)18-12-13-23(3)20(14-18)24(4,15-19(25)22(23)27)28-21(26)11-10-17-8-6-5-7-9-17/h5-11,14,16,19-20,22,25,27H,12-13,15H2,1-4H3/b11-10+/t19-,20+,22+,23+,24-/m0/s1 |
InChI Key | DRNUHBXXLRKSBG-UIMYRPBRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H32O4 |
Molecular Weight | 384.50 g/mol |
Exact Mass | 384.23005950 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 4.00 |
There are no found synonyms. |
![2D Structure of [(1S,3S,4S,4aR,8aR)-3,4-dihydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-yl] (E)-3-phenylprop-2-enoate 2D Structure of [(1S,3S,4S,4aR,8aR)-3,4-dihydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-yl] (E)-3-phenylprop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/e35921e0-86d8-11ee-92a5-61fe941d63de.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.66% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.06% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.81% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.70% | 86.33% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 92.10% | 94.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.56% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 91.46% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.48% | 95.50% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.06% | 94.62% |
CHEMBL5028 | O14672 | ADAM10 | 88.46% | 97.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.77% | 94.45% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.00% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.91% | 94.75% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.47% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.99% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.94% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.18% | 90.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.95% | 94.23% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.39% | 91.07% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.24% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brintonia discoidea |
PubChem | 163186376 |
LOTUS | LTS0071844 |
wikiData | Q104987539 |