(1R,2S,5R,8S,9R,14R,15R,17R,18R,21S,24R,26S,27S)-5,15-dihydroxy-14-methoxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-ene-4,10,22,29-tetrone
Internal ID | a89e0485-63eb-4cd5-9449-be9bef8757b5 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Physalins and derivatives |
IUPAC Name | (1R,2S,5R,8S,9R,14R,15R,17R,18R,21S,24R,26S,27S)-5,15-dihydroxy-14-methoxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-ene-4,10,22,29-tetrone |
SMILES (Canonical) | CC12CC3C4(C56C1C(=O)C(O5)(C7CC(C8(CC=CC(=O)C8(C7CCC6(C(=O)O4)O)C)OC)O)OCC2C(=O)O3)C |
SMILES (Isomeric) | C[C@]12C[C@@H]3[C@]4([C@]56[C@H]1C(=O)[C@](O5)([C@@H]7C[C@H]([C@]8(CC=CC(=O)[C@@]8([C@H]7CC[C@@]6(C(=O)O4)O)C)OC)O)OC[C@H]2C(=O)O3)C |
InChI | InChI=1S/C29H34O11/c1-23-11-18-25(3)29-19(23)20(32)28(40-29,37-12-15(23)21(33)38-18)14-10-17(31)27(36-4)8-5-6-16(30)24(27,2)13(14)7-9-26(29,35)22(34)39-25/h5-6,13-15,17-19,31,35H,7-12H2,1-4H3/t13-,14+,15-,17+,18+,19-,23+,24-,25-,26-,27-,28+,29-/m0/s1 |
InChI Key | PKBKMEUABLQCJI-PODXOSIASA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H34O11 |
Molecular Weight | 558.60 g/mol |
Exact Mass | 558.21011190 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.70% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.44% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.15% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.81% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.78% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.85% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.44% | 97.09% |
CHEMBL1871 | P10275 | Androgen Receptor | 92.16% | 96.43% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.01% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.30% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.15% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.01% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.44% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.38% | 90.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.86% | 92.62% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.20% | 94.80% |
CHEMBL2581 | P07339 | Cathepsin D | 81.64% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.88% | 96.61% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.62% | 94.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.52% | 97.79% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.15% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Physalis angulata |
Physalis minima |
PubChem | 154497215 |
LOTUS | LTS0275409 |
wikiData | Q105210289 |