dimethyl (1S,9R,16R,18S,21S)-18-hydroxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-2,18-dicarboxylate
Internal ID | 0a952ab4-253a-4146-b97d-5322511f2de7 |
Taxonomy | Alkaloids and derivatives > Aspidofractine alkaloids |
IUPAC Name | dimethyl (1S,9R,16R,18S,21S)-18-hydroxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-2,18-dicarboxylate |
SMILES (Canonical) | COC(=O)C1(CC23CCCN4C2C5(C1(CC3)N(C6=CC=CC=C65)C(=O)OC)CC4)O |
SMILES (Isomeric) | COC(=O)[C@@]1(C[C@]23CCCN4[C@@H]2[C@@]5([C@]1(CC3)N(C6=CC=CC=C65)C(=O)OC)CC4)O |
InChI | InChI=1S/C23H28N2O5/c1-29-18(26)22(28)14-20-8-5-12-24-13-11-21(17(20)24)15-6-3-4-7-16(15)25(19(27)30-2)23(21,22)10-9-20/h3-4,6-7,17,28H,5,8-14H2,1-2H3/t17-,20+,21+,22+,23-/m0/s1 |
InChI Key | GWQXRASFYLYGJN-JHVSNHCVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H28N2O5 |
Molecular Weight | 412.50 g/mol |
Exact Mass | 412.19982200 g/mol |
Topological Polar Surface Area (TPSA) | 79.30 Ų |
XlogP | 2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.02% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.79% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.14% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.50% | 90.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.15% | 91.11% |
CHEMBL5028 | O14672 | ADAM10 | 90.78% | 97.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.06% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.56% | 85.14% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.27% | 94.08% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.44% | 91.07% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.42% | 93.03% |
CHEMBL2535 | P11166 | Glucose transporter | 80.98% | 98.75% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.53% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.43% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kopsia arborea |
Kopsia dasyrachis |
PubChem | 15479227 |
LOTUS | LTS0198352 |
wikiData | Q105022683 |