[(1S,3R,4S,5S,7S,8S,9R,12S,13S,16S)-13-(furan-3-yl)-5,16-dihydroxy-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-17-methylidene-15-oxo-2,14-dioxatetracyclo[7.7.1.01,12.03,8]heptadecan-4-yl] (E)-2-methylbut-2-enoate
| Internal ID | 3ed9bd40-b175-4b2f-8a55-379520c15bc4 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | [(1S,3R,4S,5S,7S,8S,9R,12S,13S,16S)-13-(furan-3-yl)-5,16-dihydroxy-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-17-methylidene-15-oxo-2,14-dioxatetracyclo[7.7.1.01,12.03,8]heptadecan-4-yl] (E)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1C(C(C(C2(C1OC34C(C(=O)OC(C3(CCC2C4=C)C)C5=COC=C5)O)C)CC(=O)OC)(C)C)O |
| SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@@H]1[C@H]2[C@]([C@H]3CC[C@]4([C@@H](OC(=O)[C@H]([C@@]4(C3=C)O2)O)C5=COC=C5)C)([C@H](C([C@@H]1O)(C)C)CC(=O)OC)C |
| InChI | InChI=1S/C32H42O10/c1-9-16(2)27(36)40-22-23(34)29(4,5)20(14-21(33)38-8)31(7)19-10-12-30(6)25(18-11-13-39-15-18)41-28(37)24(35)32(30,17(19)3)42-26(22)31/h9,11,13,15,19-20,22-26,34-35H,3,10,12,14H2,1-2,4-8H3/b16-9+/t19-,20-,22-,23+,24+,25-,26-,30-,31+,32+/m0/s1 |
| InChI Key | UQGXIRUKWRCXHK-LNWMZUAKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H42O10 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.27779753 g/mol |
| Topological Polar Surface Area (TPSA) | 142.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.06% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.57% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.07% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.30% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.66% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.42% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.17% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.25% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.41% | 93.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.34% | 92.62% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 85.10% | 99.43% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.73% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.69% | 94.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.93% | 94.33% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.66% | 91.07% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.75% | 97.09% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.69% | 91.24% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.54% | 85.14% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.21% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.13% | 100.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.52% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ekebergia pterophylla |
| PubChem | 163188598 |
| LOTUS | LTS0137538 |
| wikiData | Q105277247 |