[(3S)-2-(2-hydroxy-3,5-dimethoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] (Z)-2-methylbut-2-enoate
Internal ID | d9e74d47-2904-488b-b184-3c528a2fae7f |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | [(3S)-2-(2-hydroxy-3,5-dimethoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC(CC=C(C)C)C(=C)C1=CC(=C(C(=C1O)OC)C)OC |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@@H](CC=C(C)C)C(=C)C1=CC(=C(C(=C1O)OC)C)OC |
InChI | InChI=1S/C22H30O5/c1-9-14(4)22(24)27-18(11-10-13(2)3)15(5)17-12-19(25-7)16(6)21(26-8)20(17)23/h9-10,12,18,23H,5,11H2,1-4,6-8H3/b14-9-/t18-/m0/s1 |
InChI Key | WSFSOZDLQDYURS-WAFIBAPDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H30O5 |
Molecular Weight | 374.50 g/mol |
Exact Mass | 374.20932405 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 5.80 |
There are no found synonyms. |
![2D Structure of [(3S)-2-(2-hydroxy-3,5-dimethoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] (Z)-2-methylbut-2-enoate 2D Structure of [(3S)-2-(2-hydroxy-3,5-dimethoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/e2eb73b0-863d-11ee-b1fb-67f6579636a1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.40% | 91.11% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.86% | 97.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.49% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.21% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 90.64% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 89.91% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.04% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.68% | 96.09% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 87.25% | 90.20% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.69% | 91.07% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.56% | 93.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.40% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.08% | 96.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.87% | 94.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.44% | 95.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.13% | 93.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.39% | 86.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.28% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio oxyodontus |
PubChem | 162885858 |
LOTUS | LTS0209256 |
wikiData | Q105311817 |