5-chloro-7,7,10',10'-tetramethylspiro[1H-pyrano[2,3-g]indole-3,11'-3,13-diazatetracyclo[5.5.2.01,9.03,7]tetradecane]-2,2',14'-trione
| Internal ID | bde3ed13-d717-4322-8f7e-3fe7dd024f36 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > 2,2-dimethyl-1-benzopyrans |
| IUPAC Name | 5-chloro-7,7,10',10'-tetramethylspiro[1H-pyrano[2,3-g]indole-3,11'-3,13-diazatetracyclo[5.5.2.01,9.03,7]tetradecane]-2,2',14'-trione |
| SMILES (Canonical) | CC1(C=CC2=C3C(=CC(=C2O1)Cl)C4(CC56C(C4(C)C)CC7(CCCN7C5=O)C(=O)N6)C(=O)N3)C |
| SMILES (Isomeric) | CC1(C=CC2=C3C(=CC(=C2O1)Cl)C4(CC56C(C4(C)C)CC7(CCCN7C5=O)C(=O)N6)C(=O)N3)C |
| InChI | InChI=1S/C26H28ClN3O4/c1-22(2)8-6-13-17-14(10-15(27)18(13)34-22)25(20(32)28-17)12-26-16(23(25,3)4)11-24(19(31)29-26)7-5-9-30(24)21(26)33/h6,8,10,16H,5,7,9,11-12H2,1-4H3,(H,28,32)(H,29,31) |
| InChI Key | OYYJASXCEOMRMB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H28ClN3O4 |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 481.1768341 g/mol |
| Topological Polar Surface Area (TPSA) | 87.70 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.64% | 94.45% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 98.24% | 93.40% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.16% | 91.11% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 94.84% | 95.34% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.48% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.39% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.30% | 96.77% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.30% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.24% | 86.33% |
| CHEMBL238 | Q01959 | Dopamine transporter | 90.41% | 95.88% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 90.33% | 99.29% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.51% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.27% | 90.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.61% | 93.99% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.43% | 82.69% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 87.57% | 90.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.37% | 90.71% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.89% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.71% | 97.09% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 85.39% | 95.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.07% | 94.75% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 84.04% | 98.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.65% | 91.03% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.20% | 96.61% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.10% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.89% | 94.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.27% | 97.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.19% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163038612 |
| LOTUS | LTS0072031 |
| wikiData | Q104194054 |