(7S,8aR,9S,10aR)-1,3-dihydroxy-10a-methyl-9-(2-methylpropyl)-7-propan-2-yl-7,8,8a,9-tetrahydroxanthene-2,4-dicarbaldehyde
Internal ID | af896e87-6944-484e-a7d8-d2cf32aec0ee |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthenes |
IUPAC Name | (7S,8aR,9S,10aR)-1,3-dihydroxy-10a-methyl-9-(2-methylpropyl)-7-propan-2-yl-7,8,8a,9-tetrahydroxanthene-2,4-dicarbaldehyde |
SMILES (Canonical) | CC(C)CC1C2CC(C=CC2(OC3=C(C(=C(C(=C13)O)C=O)O)C=O)C)C(C)C |
SMILES (Isomeric) | CC(C)C[C@H]1[C@H]2C[C@H](C=C[C@]2(OC3=C(C(=C(C(=C13)O)C=O)O)C=O)C)C(C)C |
InChI | InChI=1S/C23H30O5/c1-12(2)8-15-18-9-14(13(3)4)6-7-23(18,5)28-22-17(11-25)20(26)16(10-24)21(27)19(15)22/h6-7,10-15,18,26-27H,8-9H2,1-5H3/t14-,15-,18+,23+/m0/s1 |
InChI Key | GCAXPYWXIWWHHT-GRDTXPOLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H30O5 |
Molecular Weight | 386.50 g/mol |
Exact Mass | 386.20932405 g/mol |
Topological Polar Surface Area (TPSA) | 83.80 Ų |
XlogP | 5.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.68% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.14% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.23% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 90.62% | 98.95% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 88.71% | 98.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.48% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.15% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.56% | 97.09% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 85.41% | 83.10% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.20% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.99% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.96% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.90% | 93.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.88% | 97.25% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.71% | 89.67% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.52% | 85.11% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.75% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.02% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus globulus |
PubChem | 124300748 |
LOTUS | LTS0237228 |
wikiData | Q105006178 |